搜索结果
| ID | 拉丁名 | 药名 | 药用植物名 | 功能与主治 | 来源 | 药用部位 | 使用民族 |
|---|
| TCMBANKHE003718 | Flos Chrysanthemi | 菊花 | To dispel wind-heat, to subdue hyperactivity of the liver, and improve eyesight./Angina pectoris, hypertension, externally contracted wind-heat, wind warmth, fever and headache, dizziness, common cold, red eyes, red eyes with gall, swelling toxin of clove sore. | capitulum | |||
| TCMBANKHE005793 | Flos Chrysanthemi | 菊花 | To dispel wind-heat, to subdue hyperactivity of the liver, and improve eyesight./Angina pectoris, hypertension, externally contracted wind-heat, wind warmth, fever and headache, dizziness, common cold, red eyes, red eyes with gall, swelling toxin of clove sore. | capitulum |
| 化合物ID | 化合物名 | 别名 | 分子式 | 分子质量 | Smiles |
|---|
| TCMBANKIN000065 | dioscin | LMST01080053; C08897; 3-O-(Rhaa1-4(Rhaa1-2)Glcb)-(25R)-spirost-5-en-3beta-ol; dioscin ; 19057-60-4; Dioscin | C45H72O16 | 869.04 | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(CCC(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)C)O)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)C)OC1 |
| TCMBANKIN000096 | oridonin | Rub A | C20H28O6 | 364.4 g/mol | CC1(CCC(C23C1C(C(C45C2CCC(C4O)C(=C)C5=O)(OC3)O)O)O)C |
| TCMBANKIN003665 | evoden | C1CCN(CC1)CCOC2=CC=C(C=C2)C(=O)C3=C(SC4=C3C=CC(=C4)O)C5=CC=C(C=C5)O | |||
| TCMBANKIN029777 | vitamin d3 | C28H46O | 398.7 g/mol | CC(C)C(C)CCC(C)C1CCC2C1(CCCC2=CC=C3CC(CCC3=C)O)C | |
| TCMBANKIN058519 | (-)-epigallocatechin-3-gallate; (-)-epigallocatechin 3-o-gallate;epigallocatechin gallate; galloyl-l-epigallocatechol; epigallocatechin 3-gallate; (-)-epigallocatechin gallate; | KBio2_000796; SpecPlus_000277; 50299_FLUKA; Spectrum3_000244; KBioGR_002002; 3,4,5-trihydroxybenzoic acid [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chroman-3-yl] ester; MLS000758300; DivK1c_006373; (−)-Epigallocatechin gallate; EGCG; SPBio_000035; (−)-cis-2-(3,4,5-Trihydroxyphenyl)-3,4-dihydro-1(2H)-benzopyran-3,5,7-triol 3-gallate; KBioSS_000796; Epigallocatechin gallate; Spectrum4_001541; (-)-epigallocatechin 3-gallate; Tea catechin; AIDS000674; KBio2_005932; 3,4,5-trihydroxybenzoic acid [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3-chromanyl] ester; KBio1_001317; 989-51-5; AIDS-000674; (2R,3R)-2-(3,4,5-Trihydroxyphenyl)-3,4-dihydro-1[2H]-benzopyran-3,5,7-triol-3-(3,4,5-trihydroxybenzoate); KBio2_003364; Galloyl-L-epigallocatechol; SDCCGMLS-0066550.P001; (-)-Epigallocatechol gallate; ACon1_001054; Spectrum5_000102; Green tea extract; MEGxp0_001166; C09731; (-)-Epigallocatechin-3-o-gallate; Epigallocatechin 3-gallate; (-)-Epigallocatechin gallate; CCRIS 3729; Teavigo; [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chroman-3-yl] 3,4,5-trihydroxybenzoate; Spectrum2_000168; Benzoic acid, 3,4,5-trihydroxy-, (2R,3R)-3,4-dihydro-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2H-1-benzopyran-3-yl ester; (−)-cis-3,3′,4′,5,5′,7-Hexahydroxy-flavane-3-gallate; CHEBI:4806; (-)-epigallocatechin-3-gallate ; (-)-Epigallocatechin gallate (85% (-)-epigallocatechin gallate, 10% (-)-epigallocatechin, 5% (-)- epicatechin gallate); Catechin deriv.; SMR000449288; SPECTRUM210239; E4143_SIAL; (2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl 3,4,5-trihydroxybenzoate; Spectrum_000316; (-)-EGCG; KBio3_001128; BSPBio_001628; Epigallocatechol, 3-gallate, (-)-; Epigallocatechin-3-gallate; E4268_SIAL; epigallocatechin gallate ; epigallocatechin-3-gallate; (-)epigallocatechin-3-gallate ; EGCG; 989E515; [5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chroman-3-yl] 2,3,4-trihydroxybenzoate; HMS2051K21; CS-1258; AC1L22IG; AK165605; Green tea polyphenols, Anagen; (-)-Epigallocatechin-3-O-gallate, United States Pharmacopeia (USP) Reference Standard; AKOS015918182; CAS-989-51-5; Epigallocatechin gallate, primary pharmaceutical reference standard; W-5069; (-)-cis-3,3',4',5,5',7-Hexahydroxy-flavane-3-gallate; (-)-Epigallocatechin gallate, analytical standard; Q-100914; DSSTox_RID_78830; AN-15867; DSSTox_GSID_29889; (-)-Epigallocatechol gallate; FT-0604392; NCGC00164319-04; Green tea extract; MEGxp0_001166; (-)-Epigallocatechin-3-o-gallate; Epigallocatechin 3-gallate; N1874; CHEBI:4806; (2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl 3,4,5-trihydroxybenzoate; BG00814299; HMS3649E08; D0E9DB; Epigallocatechol, 3-gallate, (-)-; (-)-EpigallocatechinGallateHydrate; Epigallocatechin-3-gallate; AB0014381; BQM438CTEL; NC00078; ST51055716; Epigallocatechin gallate, Pharmaceutical Secondary Standard; Certified Reference Material; SpecPlus_000277; Spectrum3_000244; (2R,3R)-5,7-Dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl-3,4,5-trihydroxybenzoate; MLS000758300; (-)-Epigallocatechin gallate (EGCG); CCG-38378; Gallic acid, 3-ester with epigallocatechol, (-)-; SR-01000946601-1; NCGC00164319-01; (-)-cis-3,4-Dihydro-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-1(2H)-benzopyran-3-yl Gallate; NCGC00164319-06; DSSTox_CID_567; MCULE-3341525983; Epigallocatechin monogallate, B; Tox21_303457; SAM001247031; 4awm; K791; 989-51-5; SR-01000946601; MFCD00075940; EGCG analogs; Galloyl-L-epigallocatechol; NCGC00164319-03; (-)-Epigallocatechin gallate, >=80% (HPLC), from green tea; Spectrum5_000102; CPD000449288; (-)-Epigallocatechin gallate; LMPK12030005; E0694; Teavigo; Epigallocatechin gallate analogs, Anagen; Epigallocatechin-3-monogallate; ACN-035233; Benzoic acid, 3,4,5-trihydroxy-, (2R,3R)-3,4-dihydro-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2H-1-benzopyran-3-yl ester; Sunphenon; Epigallocatechin gallate(EGCG); s2250; PF-EGCg 90; 3,4-Dihydro-5,7-dihydroxy-2R-(3,4,5-trihydroxyphenyl)-2H-1-benzopyran-3R-yl-3,4,5-trihydroxybenzoate; 3,4,5-Trihydroxybenzoic acid (2R,3R)-3,4-dihydro-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2H-1-benzopyran-3-yl ester; MLS001424000; (-)-EGCG; ZINC3870412; KBio2_000796; EGCG cpd; KBioGR_002002; Benzoic acid, 3,4,5-trihydroxy-, 3,4-dihydro-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2H-1-benzopyran-3-yl ester, (2R-cis)-; EGCG, Anagen; NCGC00257243-01; Tox21_201468; L-Epigallocatechin gallate; cid_65064; SPBio_000035; BG01747388; Epigallocatechin gallate; KBioSS_000796; Spectrum4_001541; (-)-epigallocatechin 3-gallate; DB12116; EPIGALOCATECHIN GALLATE; ANTIOXIDANT MODEL (TRAMP) -EPIGALLOCATECHIN GALLATE; KBio2_005932; I14-7747; D0U2BH; MCULE-7760530136; 2kdh; Epigallocatechin gallate, Anagen; AOB2839; SDCCGMLS-0066550.P001; 863-65-0; FR-109; ST097428; ACon1_001054; LS-2197; CCRIS 3729; [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chroman-3-yl] 3,4,5-trihydroxybenzoate; Epigallocate; GTPL7002; BDBM50070942; C22H18O11; GTPs,Anagen; SCHEMBL35258; (2R,3R)-5,7-Dihydroxy-2-(3,4,5-trihydroxyphenyl)chroman-3-yl 3,4,5-trihydroxybenzoate; MolPort-001-741-358; DivK1c_006373; KB-206444; SR-01000759328; Teavigo;; EGCG; (-)-EPIGALLOCATECHIN GALLATE (GREEN TEA EXTRACT); HY-13653; (-)-Epigallocatechin gallate, >=95%; NCGC00259019-01; Tea catechin; DS-9030; SR-01000759328-6; SR-01000759328-5; KDH; AC1Q5X0Z; KBio1_001317; (2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chroman-3-yl 3,4,5-trihydroxyb enzoate; (2R,3R)-2-(3,4,5-Trihydroxyphenyl)-3,4-dihydro-1[2H]-benzopyran-3,5,7-triol-3-(3,4,5-trihydroxybenzoate); NVP-XAA 723; KBio2_003364; EBD2138593; FT-0082796; NCGC00164319-02; C09731; (-)-cis-2-(3,4,5-Trihydroxyphenyl)-3,4-dihydro-1(2H)-benzopyran-3,5,7-triol 3-gallate; UNII-BQM438CTEL; DTXSID1029889; WMBWREPUVVBILR-WIYYLYMNSA-N; [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate; (-)-Epigallocatehin gallate; Spectrum2_000168; (2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-3-yl 3,4,5-trihydroxybenzoate; (-)-Epigallocatechin gallate (85% (-)-epigallocatechin gallate, 10% (-)-epigallocatechin, 5% (-)- epicatechin gallate); Catechin deriv.; SMR000449288; (-)-Epigallocatechin gallat; SPECTRUM210239; Epigallocic acid; Epigallocatcchin Gallate; KS-0000132O; BP-30205; CHEMBL297453; SC-47284; Spectrum_000316; 3oob; (-)-Epigallocatechin gallate, >=97.0% (HPLC); KBio3_001128; BSPBio_001628; epigallo-catechin gallate | C22H18O11 | 458.4g/mol | C1C(C(OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O |
| TCMBANKIN058990 | forskolin | coleonol | C22H34O7 | 410.5 g/mol | CC(=O)OC1C(C2C(CCC(C2(C3(C1(OC(CC3=O)(C)C=C)C)O)C)O)(C)C)O |
| TCMBANKIN059404 | Guggulsterone | C21H28O2 | 312.45 | CC=C1C(=O)CC2C1(CCC3C2CCC4=CC(=O)CCC34C)C | |
| TCMBANKIN059579 | oridonin | C20H28O6 | 364.4 g/mol | CC1(CCC(C23C1C(C(C45C2CCC(C4O)C(=C)C5=O)(OC3)O)O)O)C | |
| TCMBANKIN059928 | emodin | C15H10O5 | 270.24 g/mol | CC1=CC2=C(C(=C1)O)C(=O)C3=C(C2=O)C=C(C=C3O)O | |
| TCMBANKIN060497 | dioscin | C45H72O16 | 869.04 | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(CCC(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)C)O)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)C)OC1 |
| 疾病ID | 疾病名 | MeSH名 | HPO名 | UMLS名 | 疾病类型 |
|---|
| TCMBANKDI000023 | Skin and Connective Tissue Diseases; Immune System Diseases | Abnormality of the immune system | Disease or Syndrome | disease | |
| TCMBANKDI000054 | Nervous System Diseases; Mental Disorders | Abnormality of the nervous system | Disease or Syndrome | disease | |
| TCMBANKDI000076 | Neoplasms | - | Neoplastic Process | group | |
| TCMBANKDI000771 | Skin and Connective Tissue Diseases | Abnormality of the integument; Abnormality of the immune system | Sign or Symptom | phenotype | |
| TCMBANKDI001706 | Musculoskeletal Diseases | Abnormality of limbs; Abnormality of the skeletal system | Disease or Syndrome | disease | |
| TCMBANKDI002441 | Neoplasms | Neoplasm; Abnormality of the skeletal system | Neoplastic Process | disease | |
| TCMBANKDI002556 | Neoplasms; Musculoskeletal Diseases; Stomatognathic Diseases | - | Disease or Syndrome | disease | |
| TCMBANKDI002718 | - | - | Finding | phenotype | |
| TCMBANKDI003248 | Nutritional and Metabolic Diseases; Endocrine System Diseases | Abnormality of metabolism/homeostasis; Abnormality of the endocrine system | Disease or Syndrome | disease | |
| TCMBANKDI003353 | Pathological Conditions, Signs and Symptoms; Neoplasms | - | Neoplastic Process | phenotype | |
| TCMBANKDI003932 | Neoplasms; Musculoskeletal Diseases | Abnormality of the skeletal system | Disease or Syndrome | disease | |
| TCMBANKDI004054 | Pathological Conditions, Signs and Symptoms | - | Neoplastic Process | phenotype | |
| TCMBANKDI004344 | Nervous System Diseases; Endocrine System Diseases | - | Disease or Syndrome | group | |
| TCMBANKDI004420 | Male Urogenital Diseases | - | Congenital Abnormality | disease | |
| TCMBANKDI004646 | Nervous System Diseases | Abnormality of the nervous system | Disease or Syndrome | disease | |
| TCMBANKDI006450 | Stomatognathic Diseases | - | Disease or Syndrome | disease | |
| TCMBANKDI006612 | Neoplasms; Female Urogenital Diseases and Pregnancy Complications | Abnormality of the genitourinary system; Neoplasm | Neoplastic Process | disease | |
| TCMBANKDI007091 | Neoplasms | - | Neoplastic Process | phenotype | |
| TCMBANKDI007228 | - | - | Finding | phenotype | |
| TCMBANKDI007618 | Hemic and Lymphatic Diseases | Abnormality of blood and blood-forming tissues | Disease or Syndrome | phenotype | |
| TCMBANKDI007770 | Pathological Conditions, Signs and Symptoms; Respiratory Tract Diseases | Abnormality of the respiratory system | Sign or Symptom | phenotype | |
| TCMBANKDI009023 | - | - | Congenital Abnormality | disease | |
| TCMBANKDI009571 | Cardiovascular Diseases | Abnormality of the cardiovascular system | Disease or Syndrome | disease | |
| TCMBANKDI009572 | Nutritional and Metabolic Diseases | Abnormality of metabolism/homeostasis | Disease or Syndrome | phenotype | |
| TCMBANKDI009575 | Congenital, Hereditary, and Neonatal Diseases and Abnormalities; Musculoskeletal Diseases | - | Disease or Syndrome | disease | |
| TCMBANKDI009657 | Congenital, Hereditary, and Neonatal Diseases and Abnormalities; Cardiovascular Diseases | Abnormality of the cardiovascular system | Congenital Abnormality | group | |
| TCMBANKDI009912 | Pathological Conditions, Signs and Symptoms | Abnormality of metabolism/homeostasis | Sign or Symptom | phenotype | |
| TCMBANKDI009951 | Nutritional and Metabolic Diseases; Musculoskeletal Diseases | Abnormality of the skeletal system | Disease or Syndrome | disease | |
| TCMBANKDI010311 | Respiratory Tract Diseases | Abnormality of the respiratory system | Disease or Syndrome | disease | |
| TCMBANKDI010700 | Eye Diseases; Nervous System Diseases | Abnormality of the nervous system; Abnormality of the eye | Disease or Syndrome | phenotype | |
| TCMBANKDI011167 | - | Abnormality of the skeletal system | Anatomical Abnormality | disease | |
| TCMBANKDI011173 | Neoplasms | - | Neoplastic Process | disease | |
| TCMBANKDI011174 | Infections | - | Disease or Syndrome | group | |
| TCMBANKDI011743 | Neoplasms; Skin and Connective Tissue Diseases | Neoplasm; Abnormality of the breast | Neoplastic Process | group | |
| TCMBANKDI011935 | Musculoskeletal Diseases | - | Disease or Syndrome | disease | |
| TCMBANKDI012603 | Neoplasms; Musculoskeletal Diseases; Stomatognathic Diseases | - | Disease or Syndrome | disease | |
| TCMBANKDI012976 | Neoplasms; Stomatognathic Diseases | - | Neoplastic Process | disease | |
| TCMBANKDI013263 | Pathological Conditions, Signs and Symptoms; Musculoskeletal Diseases | - | Acquired Abnormality | disease | |
| TCMBANKDI014088 | Respiratory Tract Diseases; Cardiovascular Diseases | Abnormality of the respiratory system; Abnormality of the cardiovascular system | Disease or Syndrome | disease | |
| TCMBANKDI014161 | Stomatognathic Diseases | Abnormality of the immune system; Abnormality of head or neck | Disease or Syndrome | group | |
| TCMBANKDI014531 | Pathological Conditions, Signs and Symptoms; Neoplasms; Musculoskeletal Diseases | - | Neoplastic Process | disease | |
| TCMBANKDI015238 | Musculoskeletal Diseases | - | Disease or Syndrome | disease | |
| TCMBANKDI015780 | - | - | Disease or Syndrome | disease | |
| TCMBANKDI016425 | Female Urogenital Diseases and Pregnancy Complications; Male Urogenital Diseases; Immune System Diseases | Abnormality of the genitourinary system; Abnormality of the immune system | Disease or Syndrome | disease | |
| TCMBANKDI016800 | Neoplasms; Female Urogenital Diseases and Pregnancy Complications; Male Urogenital Diseases | - | Neoplastic Process | disease | |
| TCMBANKDI017024 | Neoplasms; Respiratory Tract Diseases | - | Neoplastic Process | disease | |
| TCMBANKDI017474 | - | - | Disease or Syndrome | disease | |
| TCMBANKDI017534 | Musculoskeletal Diseases | - | Congenital Abnormality | disease | |
| TCMBANKDI017577 | - | Abnormality of limbs; Abnormality of the skeletal system | Anatomical Abnormality | disease | |
| TCMBANKDI018245 | Endocrine System Diseases | - | Disease or Syndrome | disease | |
| TCMBANKDI018659 | Neoplasms | - | Neoplastic Process | group | |
| TCMBANKDI018802 | - | Abnormality of the integument | Finding | disease | |
| TCMBANKDI019056 | Infections | - | Disease or Syndrome | disease | |
| TCMBANKDI019267 | Pathological Conditions, Signs and Symptoms; Nervous System Diseases | Abnormality of the nervous system | Sign or Symptom | phenotype | |
| TCMBANKDI019825 | Neoplasms | - | Neoplastic Process | disease | |
| TCMBANKDI020138 | Congenital, Hereditary, and Neonatal Diseases and Abnormalities; Nutritional and Metabolic Diseases | - | Disease or Syndrome | disease | |
| TCMBANKDI020574 | Pathological Conditions, Signs and Symptoms; Nervous System Diseases; Stomatognathic Diseases | Abnormality of the nervous system; Abnormality of head or neck; Abnormality of the musculature | Disease or Syndrome | disease | |
| TCMBANKDI020911 | Skin and Connective Tissue Diseases; Musculoskeletal Diseases; Immune System Diseases | - | Disease or Syndrome | disease | |
| TCMBANKDI021151 | - | Abnormality of the skeletal system | Finding | phenotype | |
| TCMBANKDI021382 | Pathological Conditions, Signs and Symptoms | Abnormality of the integument | Finding | phenotype | |
| TCMBANKDI021387 | Nutritional and Metabolic Diseases | Abnormality of metabolism/homeostasis | Disease or Syndrome | phenotype | |
| TCMBANKDI022565 | - | - | Finding | phenotype | |
| TCMBANKDI023464 | Nervous System Diseases | Abnormality of the nervous system | Disease or Syndrome | disease | |
| TCMBANKDI024535 | Neoplasms; Respiratory Tract Diseases | Neoplasm; Abnormality of the respiratory system | Neoplastic Process | disease | |
| TCMBANKDI024668 | Musculoskeletal Diseases; Stomatognathic Diseases | - | Disease or Syndrome | disease | |
| TCMBANKDI024875 | Nutritional and Metabolic Diseases; Musculoskeletal Diseases | - | Disease or Syndrome | disease | |
| TCMBANKDI024981 | - | Abnormality of head or neck | Disease or Syndrome | disease | |
| TCMBANKDI025104 | Infections; Respiratory Tract Diseases; Otorhinolaryngologic Diseases | Abnormality of head or neck | Disease or Syndrome | disease | |
| TCMBANKDI025420 | Digestive System Diseases; Neoplasms | Abnormality of the digestive system; Neoplasm | Neoplastic Process | disease | |
| TCMBANKDI026558 | Musculoskeletal Diseases | - | Disease or Syndrome | disease | |
| TCMBANKDI027289 | Pathological Conditions, Signs and Symptoms; Nervous System Diseases; Behavior and Behavior Mechanisms | - | Mental or Behavioral Dysfunction | disease | |
| TCMBANKDI027628 | Pathological Conditions, Signs and Symptoms; Congenital, Hereditary, and Neonatal Diseases and Abnormalities; Nutritional and Metabolic Diseases; Skin and Connective Tissue Diseases | - | Disease or Syndrome | disease | |
| TCMBANKDI028064 | - | - | Disease or Syndrome | disease | |
| TCMBANKDI028595 | Musculoskeletal Diseases | Abnormality of the skeletal system | Disease or Syndrome | disease | |
| TCMBANKDI028640 | Neoplasms | - | Neoplastic Process | disease | |
| TCMBANKDI028908 | Pathological Conditions, Signs and Symptoms; Eye Diseases; Nervous System Diseases | Abnormality of the eye | Disease or Syndrome | phenotype | |
| TCMBANKDI029899 | Neoplasms; Immune System Diseases; Hemic and Lymphatic Diseases | Neoplasm; Abnormality of blood and blood-forming tissues | Neoplastic Process | group | |
| TCMBANKDI031192 | Neoplasms; Male Urogenital Diseases | - | Neoplastic Process | disease | |
| TCMBANKDI031297 | Cardiovascular Diseases | - | Disease or Syndrome | group | |
| TCMBANKDI031439 | Stomatognathic Diseases | - | Disease or Syndrome | disease | |
| TCMBANKDI031523 | Hemic and Lymphatic Diseases | Abnormality of blood and blood-forming tissues | Disease or Syndrome | disease |