Plant Summary
Plant Information
TCMBank_ID: | TCMBANKHE005518 |
ID: | TCMBANKHE005518 |
植物拉丁名: |
|
功能与主治: | To tonify the liver and the kidney, to promote virility, and to arrest spontaneous emission./Treatment of impotence, seminal emission, aching of the loins and knee, enuresis, frequent urination, morbid leukorrhea. |
药用植物名: | 韭菜子 |
治疗类型: | 补阳药 |
TCM_ID_id: | 4487 |
SymMap_id: | 215 |
TCMSP_id: | 987 |
植物对应的化合物
| 化合物ID | 化合物名 | 别名 | 分子式 | 分子质量 | Smiles |
|---|
| TCMBANKIN001296 | Tuberostemoenone | tuberostemoenone; AC1NT1AO; azane; butane; methane; methanol; molecular hydrogen; trihydrate | 387.52 | [HH].[HH].[HH].C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.CCCC.CO.N.O.O.O | |
| TCMBANKIN001918 | 4-methyoxy-N-methylquinolin-2-one | ||||
| TCMBANKIN003756 | Methyl allyl sulfide | methyl allyl sulfide; 1-Propene, 3-(methylthio)-; NCIOpen2_003675; 3-(methylthio)prop-1-ene; 10152-76-8; ZINC02015871; Allyl methyl sulphide; 3-methylsulfanylprop-1-ene; Allyl methyl sulfide; EINECS 233-422-0; CCRIS 7066; A34201_ALDRICH; Sulfide, allyl methyl | C4H8S | 88.17 | CSCC=C |
| TCMBANKIN004553 | feruloylhistamine | C15H17N3O3 | 287.31 g/mol | COC1=C(C=CC(=C1)C=CC(=O)NCCC2=CN=CN2)O | |
| TCMBANKIN007399 | maokonine | (S)-alpha-Carboxy-4-hydroxy-N,N,N-trimethylbenzeneethanaminium, hydroxide, inner salt; 5-hydroxy-2-[2-(trimethylazaniumyl)ethyl]benzoate; Maokonine; 69168-08-7; 5-hydroxy-2-[2-(trimethylammonio)ethyl]benzoate; DTXSID40219215; Benzeneethanaminium, a-carboxy-4-hydroxy-N,N,N-trimethyl-,inner salt, (aS)-; AC1L4TD0; CTK5C9178; AC1Q22CE | C12H17NO3 | 223.27 g/mol | C[N+](C)(C)CCC1=C(C=C(C=C1)[O-])C(=O)O |
| TCMBANKIN008084 | Daturic acid | 67701-03-5; daturicacid; n-Heptadecylic acid; EINECS 266-928-5; 51610_FLUKA; 67255-22-5; 68424-37-3; NSC3743; (C16-C18)Alkylcarboxylic acid; WLN: QV16; NSC 3743; SDA 19-005-00; 8043-36-5; CH3-[CH2]15-COOH; EINECS 264-123-3; 506-12-7; LMFA01010017; AI3-36481; EINECS 208-027-1; Lead(2+) heptadecanoate; 37231-04-2; Margaric acid; 45237-52-3; n-Heptadecanoic acid; 7722-21-6; 63399-94-0; Heptadecylic acid; n-Heptadecoic acid; 39390-60-8; heptadecoic acid; 8000-11-1; (C16-C18) Alkylcarboxylic acid; daturic acid; C14-C22 Fatty acid residue; Heptadecanoic acid; Margarinsaeure; 8034-57-9; CHEBI:32365; Fatty acids, C14-22; 28829-31-4; 8034-58-0; 1338-46-1; 52051-63-5; EINECS 270-298-7; 8034-56-8; 4-02-00-01193 (Beilstein Handbook Reference); Fatty acids, C16-18; BRN 1781004; 176435-16-8; 45237-51-2; H3500_SIGMA; Margarinic acid | C17H34O2Pb | 478 g/mol | CCCCCCCCCCCCCCCCC(=O)O.[Pb] |
| TCMBANKIN008095 | bisflavanols | C1C(C(OC2=C1C=CC(=C2)O)C3=C(C(=C(C=C3C4=CC(=C(C(=C4C5C(CC6=C(O5)C(=C(C=C6O)O)O)O)O)O)O)O)O)O)O | |||
| TCMBANKIN008880 | ephedradine a | AC1Q6PBO; orantine; CCRIS 3986; orantin; (3r,3ar,15s)-3-(4-hydroxyphenyl)-3,3a,6,7,8,9,10,11,12,13,14,15-dodecahydro-4h-1,16-etheno-5,15-(propanoiminoethano)furo[3,4-l][1,5,10]triazacyclohexadecine-4,21-dione; Orantine; J1E0LYG58A; 71461-13-7; AC1L2Q4Q; LS-188743; 4H-1,16-Etheno-5,15-(propaniminoethano)furo(3,4-l)(1,5,10)triazacyclohexadecine-4,21-dione, 3,3a,6,7,8,9,10,11,12,13,14,15-dodecahydro-3-(4-hydroxyphenyl)-, (3R,3aR,15S)-; A9529; Ephedradine A; UNII-J1E0LYG58A | C28H36N4O4 | 492.61 | C1CCN2CCCNC(=O)CC(C3=CC4=C(C=C3)OC(C4C2=O)C5=CC=C(C=C5)O)NCCCNC1 |
| TCMBANKIN010852 | Tuberosine B | tuberosine b | 193.22 | C1CNC2=CC=CC=C2C1(C(=O)O)O | |
| TCMBANKIN011901 | 2-methyldisulfanylpropane | Methyl isopropyl disulphide; 40136-65-0; EINECS 254-808-5; Disulfide, methyl 1-methylethyl; Isopropyl methyl disulphide | C4H10S2 | 122.25 | CC(C)SSC |
| TCMBANKIN017993 | vitamin c | D01CWN; Cell C; Ronotec 100; P 1110; Suncoat VC 40; D-threo-hex-2-enoic acid gamma-lactone; Citrovit; 2-o-(beta-d-glucopyranosyl)-ascorbic acid_qt; Juvamine; SCHEMBL13468284; Vasc; CHEBI:51384; D-Lyxoascorbic acid; CHEMBL1253320; AK481251; Chewcee; D-xyloascorbic acid; C8DQ5M1Y1E; MLS001066386; AK322241; Ascorbic acid, D-; AC1LD8K5; E 300; Scorbu C; 10504-35-5; Ascorbicacid; l(+)-ascorbic acid; ZINC100006137; L-ascorbate (vitamin C); (5S)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxyfuran-2(5H)-one; (+)-Ascorbic acid; UNII-C8DQ5M1Y1E; Ascorbinsaure; Ceklin; VC 97; (2S)-2-[(1R)-1,2-bis(oxidanyl)ethyl]-4,5-bis(oxidanyl)furan-3-one; Vicin; L-ascorbate acid; L-ascorbic acid; L-dehydroascorbic acid; ascorbate; D-threo-hex-2-enono-1,4-lactone; Kangbingfeng; D-Ascorbic acid; Viscorin 100M; ZINC100028197; (2S)-2-[(1R)-1,2-dihydroxyethyl]-4,5-dihydroxy-3-furanone; L-Ascorbic acid (8CI,9CI); Proscorbin Redoxon Ribena Ronotec 100; Hex-2-enonic acid gamma-lactone, L-threo; (5S)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxy-2,5-dihydrofuran-2-one; Ascorbic acid; DL-Ascorbic acid; AKOS000278050; Cebion, gamma-lactone; F91F7DA3-A3D5-4FB4-A6E7-C497C48D192A; GTPL4651; SMR000471843; Xyloascorbic acid, L-; Rontex 100; Rovimix C; (2S)-2-[(1R)-1,2-dihydroxyethyl]-4,5-dihydroxyfuran-3-one; A828310 | C6H8O6 | 176.12 | C(C(C1C(=C(C(=O)O1)O)O)O)O |
| TCMBANKIN023074 | Methyldithio-1-propene | Methyl propenyl disulfide; [(E)-prop-1-enyl]disulfanylmethane; (1E)-1-(Methyldisulfanyl)-1-propene; (E)-1-propenyl methyl disulfide; 1-Propenyl methyl disulfide; Disulfide, methyl propenyl; prop-1-enyldisulfanylmethane; EINECS 227-605-4; Methyl 1-propenyl disulfide; Methyl prop-1-enyl disulphide; Disulfide, methyl 1-propenyl, E; FEMA No. 3576; Disulfide, methyl 1-propenyl, trans; (E)-1-methyldisulfanylprop-1-ene; 5905-47-5; Disulfide, methyl 1-propenyl; 1-methyldisulfanylprop-1-ene | C4H8S2 | 120.24 | CC=CSSC |
| TCMBANKIN025481 | macrocyclic spermine | ||||
| TCMBANKIN027308 | mahuangnin b | C1C(C(OC2=C1C=CC3=C2C4C(C(O3)(OC5=CC(=CC(=C45)O)O)C6=CC=C(C=C6)O)O)C7=CC=C(C=C7)O)O | |||
| TCMBANKIN029536 | 2-METHYLTHIOPHENE | CCRIS 2936; ZINC02034789; BRN 0103734; EINECS 209-063-0; AI3-15911; 69360_FLUKA; InChI=1/C5H6S/c1-5-3-2-4-6-5/h2-4H,1H; alpha-Methylthiophene; M84208_ALDRICH; Thiophene, 2-methyl-; 554-14-3; 5-17-01-00324 (Beilstein Handbook Reference) | C5H6S | 98.17 | CC1=CC=CS1 |
| TCMBANKIN030377 | majonoside r1 | majonosider1; AC1O3DM4; (2S,3R,4S,5S,6R)-2-[(2R,3R,4S,5S,6R)-2-[[3,12-dihydroxy-17-[5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl]oxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol | C42H72O15 | 817 g/mol | CC1(C(CCC2(C1C(CC3(C2CC(C4C3(CCC4C5(CCC(O5)C(C)(C)O)C)C)O)C)OC6C(C(C(C(O6)CO)O)O)OC7C(C(C(C(O7)CO)O)O)O)C)O)C |
| TCMBANKIN033051 | mahuangnin d | C1C(C(OC2=C3C4CC(OC5=CC(=CC(=C45)O)O)(OC3=CC(=C21)O)C6=CC=C(C=C6)O)C7=CC=C(C=C7)O)O | |||
| TCMBANKIN033587 | ephedrannin a | ephedrannin A | C30H20O11 | 556.47 | C1=CC(=CC=C1C2=C(C(=O)C3=C(O2)C4=C(C=C3O)OC5(C(C4C6=C(C=C(C=C6O5)O)O)O)C7=CC=C(C=C7)O)O)O |
| TCMBANKIN036901 | myristic acid | 1-Tridecanecarboxylic acid; Myristinsaeure; CH3-[CH2]12-COOH; 70079_FLUKA; AI3-15381; LMFA01010014; CH3-[CH2]12-COO(-); NCGC00091068-02; Myristic acid-[9,10-3H]; C06424; Emery 655; myristic acid ; NSC 5028; 70082_FLUKA; C14 fatty acid; ST023797; W276405_ALDRICH; CCRIS 4724; Kortacid 1499; 3uev; TUNFSRHWOTWDNC-UHFFFAOYSA-M; Tetradecanoic acid; EINECS 250-924-5; n-Tetradecoic acid; 4-02-00-01126 (Beilstein Handbook Reference); Hydrofol acid 1495; MYR; BRN 0508624; Myristate; Myristic acid (natural); Tetradecanoate; LS-190125; Crodacid; Myristic acid (8CI); EINECS 208-875-2; Prifac 2942; Myristic acid; AIDS002505; tetradecoate; W276413_ALDRICH; FEMA No. 2764; HSDB 5686; Philacid 1400; CHEBI:28875; Edenor C 14; n-tetradecoate; 45184-05-2; myristicacid; tetradecoic acid; n-Tetradecanoic acid; M3128_SIGMA; AIDS-002505; Univol U 316S; Lead dimyristate; AC1N2PSK; NCGC00091068-01; neo-Fat 14; NSC5028; Tetradecanoic acid (9CI); Hystrene 9014; Myristic acid, pure; M4792_SIGMA; CHEBI:30807; n-Tetradecan-1-oic acid; WLN: QV13; 1-tetradecanecarboxylate; 32112-52-0; n-tetradecan-1-oate; 544-63-8 | C14H28O2 | 228.371 | C([H])([H])(C([H])([H])C([H])([H])C([H])([H])C([H])([H])C(O[H])=O)C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] |
| TCMBANKIN041272 | stearic acid | 4-02-00-01206 (Beilstein Handbook Reference); AIDS-049230; Emersol 871; 8039-52-9; 126539-56-8; stearic acid, ion(1-); D00119; octadecoic acid; Hydrofol Acid 150 (VAN); 134503-33-6; Fatty acids C16-18; 68937-76-8; Kam 2000; VLZ 200; Lunac S 98; Glycon S-80; Hy-phi 1205; Lunac YA; Pristerene 9429; Pristerene 4900; Octadecanoic acid (9CI); Hystrene 9718NF; Edenor FHTI; Cetylacetic acid; NAA 173; NSC 25956; Lunac S 90; S 30C S 30C (fatty acid); Neo-Fat 18-61; Dar-chem 14; NSC25956; Edenor HT-JG 60; Octadecanoate; 57485-56-0; Oktadekansaeure; S 300 (fatty acid); Unister NAA 180; Industrene 5016; Prisorine 3508; Hydrofol Acid 150; Hystrene 4516; G 270; Stearic Acid Cherry; Century 1230; 822-16-2 (SODIUM SALT); NCGC00091596-02; Glycon S-90; 85404-83-7; NCGC00091596-01; Stearic acid (JP15/NF); Hystrene 5016; Hy-phi 1303; Glycon S-70; C01530; Octadecansaeure; Neo-Fat 18-55; WO 2 (fatty acid); Pristerene 9559; SA 200; Century 1240; Stearic acid, pure; Sunfat 18S; WO 2; CHEBI:28842; Industrene 5016K; LS-2392; Kam 3000; BRN 0608585; Edenor ST 20; AIDS049230; Lunac 30; EINECS 273-087-8; Emersol 150; 175366_SIAL; 8039-54-1; Fatty acids, C16-20; stearicacid; Stearic acid ion(1-)salt; Stearic acid (8CI); Stearinsaeure; Emersol 153NF; Hydrofol acid 1855; 57-11-4; Lunac S 30; Hystrene T 70; Prisorine 3501; Haimaric MKH(R); Stearex Beads; Groco 55; Hystrene S-97; Neo-Fat 18-54; W303518_ALDRICH; Hydrofol acid 1655; Nonsoul SN 1 (*Sodium salt*); EINECS 200-313-4; 39390-61-9; Emersol 120; EPA Pesticide Chemical Code 079082; Lunac S 20; Octadecanoic acid, ion(1-); 8013-28-3; AI3-00909; Kortacid 1895; FEMA No. 3035; Hystrene S 97; 82497-27-6; Tegostearic 254; SNA-2000 (*Sodium salt*); 1-Heptadecanecarboxylic acid; AC1MHWEJ; STL280244; 27405_RIEDEL; Steric acid; Industrene 9018; Glycon dp; F 3 (lubricant); Hy-phi 1401; Lunac S 50; Emersol 132; Stearic acid, ion(1-) (8CI); CH3-[CH2]16-COO(-); acide octadecanoique; Groco 55l; 73297_FLUKA; Serfax MT 90; Stearic acid [USAN:JAN]; 8039-51-8; acide stearique; Kam 1000; Acidum stearinicul; InChI=1/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20; 8039-53-0; 17FA; Stearophanic acid; 8037-83-0; Hystrene 7018; FA 1655; Prisorine 3502; Nonsoul SK 1; Hydrofol Acid 1895; Lunac S 40; Stearic acid 50; 8023-06-1; 85679_FLUKA; HSDB 2000; n-Octadecanoate; 400JB9103-88; Glycon tp; Unimac 5680; Loxiol G 20; Stearate; 875D; Octadecanoic acid; Neo-Fat 18-53; octadecanoate (n-C18:0); Radiacid 0427; Emery 871; Vanicol; Vis-Plus; PD 185; EINECS 250-178-0; AKOS022105769; 646-29-7; Edenor ST 1; S 300; Caswell No. 801D; Selosol 920; Tegostearic 272; Isostearic acid EX; A 1760; WLN: QV17; Stearic acid (TN); Pearl stearic; 609343-71-7; Palmitic acid - stearic acid mixture; Emersol 875; Industrene 8718; Hystrene 9718NFFG; NCGC00164255-02; ST023799; LMFA01010018; Groco 54; Edenor C18; Hystrene T-70; Hy-phi 1199; CTK8J8420; n-Octadecanoic acid; Groco 58; Pristerene 4963; Formula 300; AFCO-Chem B 65; CCRIS 2305; Industrene R; Century 1220; S4751_SIGMA; Neo-Fat 18; 58392-66-8; Barolub FTA; Hystrene 9718; CH3-[CH2]16-COOH; STE; 8037-40-9; 30399-84-9; Lunac S 90KC; Hydrofol 1895; Emery 875D; Century 1210; QIQXTHQIDYTFRH-UHFFFAOYSA-M; Neo-Fat 18-59; LS-1388; Groco 59; Humko Industrene R; Hystrene 80; Adeka Fatty Acid SA 910; Stearic acid; Prifac 2918; Emersol 6349; Edenor C 18/98; 3uex; LS-97707; CHEBI:25629; Neo-Fat 18-S; Stearic acid - palmitic acid mixture; Tegostearic 255; C-Lube 10 | C18H36O2 | 284 | C([H])([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C(O[H])= O |
| TCMBANKIN042846 | ephedradine c | Ephedradine c | C30H40N4O5 | 536.66 | COC1=C(C=C(C=C1)C2C3C4=C(O2)C=CC(=C4)C5CC(=O)NCCCN(C3=O)CCCCNCCCN5)OC |
| TCMBANKIN045099 | ephedradine b | 71327-57-6; 4H-1,16-Etheno-5,15-(propaniminoethano)furo(3,4-l)(1,5,10)triazacyclohexadecine-4,21-dione, 3,3a,6,7,8,9,10,11,12,13,14,15-dodecahydro-3-(4-hydroxy-3-methoxyphenyl)-, (3R-(3R*,3aR*,15S*))-; DTXSID80221519; Ephedradine B; AC1L4FH6 | C29H38N4O5 | 522.64 | COC1=C(C=CC(=C1)C2C3C4=C(O2)C=CC(=C4)C5CC(=O)NCCCN(C3=O)CCCCNCCCN5)O |
| TCMBANKIN049200 | Dimethyl tetrasulfide | 85931-55-1; Tetrasulfide, dimethyl; 5756-24-1; methyldisulfanyldisulfanylmethane; EINECS 227-278-8; Dimethyl tetrasulphide; dimethyl tetrasulfide | C2H6S4 | 158.33 | CSSSSC |
| TCMBANKIN057941 | l-ascorbic acid;ascorbicacid | l-ascorbic acid;ascorbic acid ; LS-187838 | C6H8O6 | 176.12 g/mol | C(C(C1C(=C(C(=O)O1)O)O)O)O |
| TCMBANKIN057972 | docosandioic acid | LMFA01170037; Docosandioic acid; 1,22-Docosanedioic acid; NSC56159; 43950_FLUKA; 505-56-6; 1,20-Eicosanedicarboxylic acid; AIDS-002598; 306673_ALDRICH; AIDS002598; Phellogenic acid; Docosanedioic acid | C22H42O4 | 370.6 g/mol | C(CCCCCCCCCCC(=O)O)CCCCCCCCCC(=O)O |
| TCMBANKIN057993 | maokonine | (S)-alpha-Carboxy-4-hydroxy-N,N,N-trimethylbenzeneethanaminium, hydroxide, inner salt; 5-hydroxy-2-[2-(trimethylazaniumyl)ethyl]benzoate; Maokonine; 69168-08-7; 5-hydroxy-2-[2-(trimethylammonio)ethyl]benzoate; DTXSID40219215; Benzeneethanaminium, a-carboxy-4-hydroxy-N,N,N-trimethyl-,inner salt, (aS)-; AC1L4TD0; CTK5C9178; AC1Q22CE;1-tyrosine betaine | C12H17NO3 | 223.27 g/mol | C[N+](C)(C)CCC1=C(C=C(C=C1)[O-])C(=O)O |
| TCMBANKIN058052 | diAllS2 | 3-prop-2-enyldisulfanylprop-1-ene; NSC 29228; Di(2-propenyl) disulfide; W202800_ALDRICH; Allyl disulphide; 3,3'-dithiobis(prop-1-ene); NCI60_002410; ZINC01531082; AI3-35128; SPECTRUM1505174; HSDB 595; 3-(prop-2-en-1-yldisulfanyl)prop-1-ene; 2179-57-9; Allyl disulfide; AIDS-005092; BRN 1699241; Diallyl disulphide; NCGC00095294-01; NSC29228; CHEBI:4488; Disulfide, di-2-propenyl; AIDS005092; C08369; 317691_ALDRICH; 3-allyldisulfanylprop-1-ene; 2-Propenyl disulfide; 3,3'-disulfanediylbis(prop-1-ene); 3-(allyldisulfanyl)-1-propene; 4,5-Dithia-1,7-octadiene; 4-01-00-02098 (Beilstein Handbook Reference); FEMA No. 2028; NCGC00095294-02; EINECS 218-548-6; 32621_FLUKA; CCRIS 6290; Diallyl disulfide; 2-Propenyl disulphide;allyl disulfide;diallyldisulfide;CAS-2179-57-9; DSSTox_RID_79248; CCG-214421; NCI60_002410; C-27435; Jsp004430; AI3-35128; HSDB 595; di-Propenyl disulfide; Allyl disulfide; 3-(prop-2-en-1-yldisulfanyl)prop-1-ene; SPECTRUM1505174; ZINC1531082; LS-16413; NCGC00095294-01; DTXSID9035206; TC-040016; UNII-609MRV3T0J component PFRGXCVKLLPLIP-UHFFFAOYSA-N; CHEBI:4488; SCHEMBL93944; MolPort-003-665-653; SR-05000002379; MFCD00008656; Garlicin?; DSSTox_CID_15206; CJ-24085; NSC-29228; Disulfide,di-2-propenyl; TRA0072391; FCH1114751; 2-Propenyl disulphide; Di(2-propenyl) disulfide; 3-(Allyldisulfanyl)-1-propene; 3-Allyldisulfanyl-Propene; Allyl disulfide, United States Pharmacopeia (USP) Reference Standard; AN-20744; FEMA 2028; diAllS2; CTK3J1568; CHEMBL366603; J-014293; Allitin; ACMC-1CDL1; Allyl disulfide, >=80%, FG; BDBM50318453; AC1L28A0; Disulfide, di-2-propen-1-yl; 1,2-Diallyldisulfane; A815665; FEMA No. 2028; 7491AF; NCGC00095294-02; API0002303; AKOS015840490; AK307043; ANW-24581; 3-(prop-2-enyldisulfanyl)prop-1-ene; 5HI47O6OA7; NSC 29228; DB-003623; Allyl disulphide; diprop-2-enyl disulfide; CJ-05228; 3,3'-dithiobis(prop-1-ene); Allyl disulfide, technical grade, 80%; DIALLYL DISULFIDE; 2179-57-9; Diallyldisulfide; ST51038174; KS-00000V5X; 3-(Allyldisulfanyl)-1-propene #; Diallyl disulfide, analytical standard; C6H10S2; 2-Propenyl disulfide; 4,5-Dithia-1,7-octadiene; D0071; EINECS 218-548-6; Diallyl disulfide, >=98% (HPLC); CCRIS 6290; PFRGXCVKLLPLIP-UHFFFAOYSA-N; Tox21_302178; MCULE-7486690483; UNII-5HI47O6OA7; 3-(allyldisulfanyl)prop-1-ene; Di-2-propenyl disulfide, 9CI; I09-0165; RTC-040016; KSC491K6R; NCGC00255533-01; BRN 1699241; Diallyl disulphide; NSC29228; DSSTox_GSID_35206; Disulfide, di-2-propenyl; CC-26440; C08369; 3,3'-disulfanediylbis(prop-1-ene); SC-77190; di-2-Propenyl disulfide; diallyldisulphide; 3-(prop-2-enyldisulfanyl)-1-propene; AC1Q7EA7; FT-0624594; SR-05000002379-1;diallyl disulfide ; diallyl disulfide | C6H10S2 | 146.27 | C=CCSSCC=C |
| TCMBANKIN058517 | ent-epiafzelechin-(2α→o→7, 4α→8)-(+)-afze-lechin | ent-epiafzelechin-(2α→o→7,4α→8)-epi-afze-lechin;ent-epiafzelechin-(2α→o→7,4α→8)-(?)-afze-lechin | C30H24O10 | C1C(C(OC2=C3C4C(C(OC5=CC(=CC(=C45)O)O)(OC3=CC(=C21)O)C6=CC=C(C=C6)O)O)C7=CC=C(C=C7)O)O | |
| TCMBANKIN058525 | mahuangnin c | mahuannin c | C30H24O10 | 544.51 | C1C(C(OC2=CC3=C(C4C(C(O3)(OC5=CC(=CC(=C45)O)O)C6=CC=C(C=C6)O)O)C(=C21)O)C7=CC=C(C=C7)O)O |
| TCMBANKIN058648 | m-DITHIANE | dithiane-1,3; 43745_FLUKA; NSC 157830; ZINC03861206; NSC157830; 157872_ALDRICH; 1,3-Dithian; 1,3-Dithiane; Dithiane-1,3 [French]; 1,3-Dithiacyclohexane; CCRIS 6777; InChI=1/C4H8S2/c1-2-5-4-6-3-1/h1-4H; EINECS 208-006-7; AI3-62288; CHEBI:47845; 505-23-7; 1,3-dithiane | C4H8S2 | 120.24 | C1CSCSC1 |
| TCMBANKIN058837 | Supraene | trans-Squalene; SQUALENE; 94016-35-0; 2,6,10,14,18,22-Tetracosahexaene, 2,6,10,15,19,23-hexamethyl-; (E,E,E,E)-Squalene; InChI=1/C30H50/c1-25(2)15-11-19-29(7)23-13-21-27(5)17-9-10-18-28(6)22-14-24-30(8)20-12-16-26(3)4/h15-18,23-24H,9-14,19-22H2,1-8H3/b27-17+,28-18+,29-23+,30-24; 442785_SUPELCO; Squalene, Spinacene, Supraene; AIDS-017396; 2,6,10,15,19,23-Hexamethyltetracosa-2,6,10,14,18,22-hexaene; 2,6,10,15,19,23-Hexamethyl-2,6,10,14,18,22-tetracosahexaene; All-trans-Squalene; 111-02-4; EINECS 203-826-1; (14E)-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene; 2,6,10,14,18,22-Tetracosahexaene, 2,6,10,15,19,23-hexamethyl-,; S3626_SIGMA; 7683-64-9; CHEBI:15440; 2,6,10,14,18,22-tetracosahexaene, 2,6,10,15,19,23-hexamethyl-, (6E,10E,14E,18E)-; 2,6,10,15,19,23-Hexamethyltetracosa-(2E,6E,10E,14E,18E,22E)-2,6,10,14,18,22-hexaene; AIDS017396; Spinacene; C00751; NSC93748; (all-E)-2,6,10,15,19,23-hexamethyl-2,6,10,14,18,22-tetracosahexaene; LMPR01060008; 2,6,10,14,18,22-Tetracosahexaene, 2,6,10,15,19,23-hexamethyl-, (all-E)-; CCRIS 711; (6E,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene;squalene | C30H50 | 410.72 | CC(=CCCC(=CCCC(=CCCC=C(C)CCC=C(C)CCC=C(C)C)C)C)C |
| TCMBANKIN059917 | methylbenzol | C6H5CH3 | 92.14 g/mol | CC1=CC=CC=C1 | |
| TCMBANKIN060868 | trans-2,4-decadienal | C10H16O | 152.23 g/mol | CCCCCC=CC=CC=O | |
| TCMBANKIN060879 | Linolic acid | C18H32O2 | 280.4 g/mol | CCCCCC=CCC=CCCCCCCCC(=O)O | |
| TCMBANKIN060888 | caproaldehyde | C6H12O | 100.16 g/mol | CCCCCC=O | |
| TCMBANKIN060891 | 2-Amyl furan | C9H14O | 138.21 g/mol | CCCCCC1=CC=CO1 | |
| TCMBANKIN060903 | Octylene;1-octene | C8H16 | 112.21 g/mol | CCCCCCC=C | |
| TCMBANKIN060918 | WLN: VH6 | C7H14O | 114.19 | CCCCCCC=O | |
| TCMBANKIN060958 | oleic acid;cis-oleic acid;oleinic acid | C18H34O2 | 282.46 | CCCCCCCCC=CCCCCCCCC(=O)O | |
| TCMBANKIN060966 | gondoic acid | C20H38O2 | 310.5 g/mol | CCCCCCCCC=CCCCCCCCCCC(=O)O | |
| TCMBANKIN061024 | tetradecane | C14H28 | 196.39 g/mol | CCCCCCCCCCCCC=C | |
| TCMBANKIN061029 | myristic acid | C14H28O2 | 228.37 | CCCCCCCCCCCCCC(=O)O | |
| TCMBANKIN061045 | PENTADECYLIC ACID | C15H30O2 | 242.4 g/mol | CCCCCCCCCCCCCCC(=O)O | |
| TCMBANKIN061058 | n-hexadecane | C16H34 | 226.44 g/mol | CCCCCCCCCCCCCCCC | |
| TCMBANKIN061091 | stearic acid | CH3(CH2)16COOH | 284.5 g/mol | CCCCCCCCCCCCCCCCCC(=O)O | |
| TCMBANKIN061105 | Eicosanoic acid | C20H40O2 | 312.53 g/mol | CCCCCCCCCCCCCCCCCCCC(=O)O | |
| TCMBANKIN061128 | n-tetracosanoic acid | C24H48O2 | 368.64 g/mol | CCCCCCCCCCCCCCCCCCCCCCCC(=O)O | |
| TCMBANKIN061192 | heptanol | C7H16O | 116.2 | CCCCCCCO |
植物对应的疾病
| 疾病ID | 病名 | 疾病类型 | MeSH | 参考文献 |
|---|
植物对应的靶点
| 靶点ID | 基因名 | 基因别名 | 描述 | 染色体位置 | Map_Location | 基因类型 |
|---|
滇ICP备16009434号-1 |
Dai SX Lab