Plant Summary
Plant Information
TCMBank_ID: | TCMBANKHE004546 |
YEM_ID: | YEM-320 |
ID: | TCMBANKHE004546/YEM-320 |
植物拉丁名: |
|
功能与主治: | To clear heat and resolve summerheat, resolve summerheat and engender liquid, disinhibit urine./Summerheat-heat vexation and thirst, exuberant heat fluid damage, inhibited urination, throat impediment, mouth sore. |
药用植物名: | 西瓜 |
药名: | 西瓜 |
来源: | 云南民族药物志：第二卷 |
药用部位: | fruit |
使用民族: | 傣族/佤族/壮族 |
药味: | Cold; Sweet; Neutral |
经络: | Stomach; Heart |
临床特征: | 1. An active component, citrulline, raises urea level in blood and in urine, thus promotes diuresis.2. Oral administration of cucurbocitrin, another active component, or its aqueous extract can lower blood pressure and capillary pressure in healthy person |
治疗类型: | 清热 |
TCM_ID_id: | 6023 |
TCMSP_id: | 736 |
植物对应的化合物
| 化合物ID | 化合物名 | 别名 | 分子式 | 分子质量 | Smiles |
|---|
| TCMBANKIN001863 | gamma-aminobutyric acid | NCGC00015043-01; gamma Aminobutyric acid; GABA hydrochloride; Piperidinic acid; Spectrum3_001385; NINDS_000616; NSC 27418; 4-Aminobutyric acid hydrochloride; LMFA01100039; gamma-Aminobutanoic acid; gamma-Aminobutyric acid; QPGLUEKHBNOAHG-UHFFFAOYSA-N; NCGC00024546-03; 28805-76-7; Aminalon; Gamarex; Tocris-0344; D00058; Oprea1_584567; DF 468; 3131-86-0; Butyric acid, 4-amino- (7CI,8CI); Immu-G; EU-0100005; NSC32044; 5959-35-3; 4-aminobutyrate hydrochloride; MCULE-3615304273; Chemical Name: .gamma.-Aminobutanoic acid; InChI=1/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7; NCGC00024546-04; SPECTRUM1500678; BUTANOIC ACID,4-AMINO 4-AMINO,BUTYRIC ACID; 0S3LEB8Q58; gamma-Aminobutyric acid-carboxy-14C; Gamastan; BSPBio_002970; PDSP1_001275; Gammalon; Spectrum2_001208; gamma-Aminobuttersaeure; 56-12-2; a-Aminobutyric acid; Gamulin; nchembio.78-comp12; Gaballon; AC1L4OHW; gamma-Aminobutyric acid hydrochloride; PDSP2_001259; SMR000058285; KBio1_000616; 4-NH2-but; Butanoic acid,4-amino-, hydrochloride (1:1); Acide amino-4- butyrique [French]; 4-aminobutyrate; MLS000028505; EINECS 227-724-1; DTXSID50208256; 4-aminobutyric acid; NCGC00024546-01; KBio2_005565; ST5330631; Butanoic acid, amino-; AK498572; CCG-213774; 4-Aminobutyric acid HCl; Reanal; BG00901312; EPA Pesticide Chemical Code 030802; Gamma-Aminobutyric acid (JAN); UNII-0S3LEB8Q58; gamma-Aminobuttersaeure [German]; NSC27418; AC1Q3E7S; to_000021; Spectrum5_001425; Lopac-A-2129; KBioSS_000429; .gamma.-Aminobutanoic acid; A2129_SIGMA; g-Aminobutyric acid; 56-12-2 (Parent); KBio3_002190; SPBio_000996; Gammalon (TN); 4-NH3-but; NCGC00024546-06; NSC51295; CTK5B0181; Gammalone; Piperidic acid; WLN: Z3VQ; SGCUT00121; IDI1_000616; GABA; EINECS 200-258-6; CCRIS 3721; gamma-aminobutyrate; Spectrum_000049; gamma-Aminobutryic acid; KBio2_000429; KBio2_002997; 70582-09-1; omega-aminobutyric acid; Spectrum4_000809; Aminobutanoic acid; 4-aminobutanoic acid,hydrochloride; butanoic acid, 4-amino-; gamma-amino-n-butyric acid; Mielomade; 4-AMINO-BUTYRATE; GAMMA(AMINO)-BUTYRIC ACID HYDROCHLORIDE; Biomol-NT_000230; 4-aminobutanoic acid hydrochloride(1:1); 4-aminobutanoic acid hydrochloride; 4-aminobutanoate; A5835_SIGMA; Lopac0_000005; GAMMA-AMINO-BUTANOIC ACID; CHEBI:16865; 4-amino-butanoic acid; 4-amino-n-butyric acid; Gammar; C00334; Mielogen; Gamma-aminobutyric acid [JAN]; Gammagee; GAMMA(AMINO)-BUTYRIC ACID; NSC45460; AI3-26812; 3-Carboxypropylamine; A7463_SIGMA; Butyric acid, 4-amino-; .gamma.-Aminobutyric acid; SCHEMBL115987; DivK1c_000616; Gammasol; AKOS024400865; Aminobutyric acid; 4-Aminobutanoic acid; KBioGR_001297; Butanoic acid, 4-amino- (9CI) | C4H10ClNO2 | 139.58 g/mol | C(CC(=O)O)CN.Cl |
| TCMBANKIN005879 | cyclooctane, 1, 2- diethyl- | C12H24 | 168.32 g/mol | CCC1CCCCCCC1CC | |
| TCMBANKIN008336 | indole-3-acetonitrile | indole-3-acetonitrile | C10H8N2 | 156.18 g/mol | C1=CC=C2C(=C1)C(=CN2)CC#N |
| TCMBANKIN010046 | 1,5-dimethylnaphthalene | Naphthalene, 1,5-dimethyl-; NSC 59388; STL280252; EINECS 209-338-5; 1,5-DIMETHYLNAPHTHALENE; ZINC1689598; SDDBCEWUYXVGCQ-UHFFFAOYSA-N; CHEBI:48608; NSC-59388; MCULE-5875168245; 571-61-9; 1,5-dimethyl-naphthalene; DTXSID0060351; ACMC-209lwa; I14-46900; 60CM3233U9; CC-03435; AC1L1X2P; UNII-60CM3233U9; InChI=1/C12H12/c1-9-5-3-8-12-10(2)6-4-7-11(9)12/h3-8H,1-2H; AKOS005208625; D2764; CHEMBL435106; D0748; Ambap571-61-9; 1,5-DMN; Naphthalene,5-dimethyl-; VZ20741; KB-10655; FCH1116656; Naphthalene, 1,5-dimethyl- (8CI)(9CI); ST45022252; 1,5-Dimethyl naphthalene; FT-0606972; CJ-28014; 1,5-dimethylnaph-thalene; NSC59388; BDBM50159247; MolPort-003-928-587; MFCD00004038; ANW-32648; AK386345; 1,5-Dimethylnaphthalene, 98%; TC-121393; C-03571 | C12H12 | 156.22 | CC1=C2C=CC=C(C2=CC=C1)C |
| TCMBANKIN013929 | pyranone | C8H10O3 | CCC1=CC(=CC(=O)O1)OC | ||
| TCMBANKIN015166 | stearaldehude | ||||
| TCMBANKIN015868 | stigmastan-6,22-dien,3,5-dedi-hydro | C29H46 | 394.7 g/mol | CCC(C=CC(C)C1CCC2C1(CCC3C2C=CC45C3(CCC4C5)C)C)C(C)C | |
| TCMBANKIN016499 | tridecane,4-cyclohexyl | C19H38 | 266.5 g/mol | CCCCCCCCCC(CCC)C1CCCCC1 | |
| TCMBANKIN017003 | glycolic acid | glycolicacid | C2H4O3 | 76.05 g/mol | C(C(=O)O)O |
| TCMBANKIN017304 | palmitic acid,ethyl este | ||||
| TCMBANKIN019943 | Furan, 2-butyl- | C8H12O | 124.18 g/mol | CCCCC1=CC=CO1 | |
| TCMBANKIN023303 | cis,cis-6,9-Pentadecadiene-1-ol | ||||
| TCMBANKIN023355 | alpha-amino-beta-(pyrazolyl-n)propionic acid | α-amino-β-(pyrazolyl-n)propionicacid | C6H9N3O2 | 155.15 g/mol | C1=CN(N=C1)CC(C(=O)O)N |
| TCMBANKIN023717 | octadecanoic acid,2-oxo-methyl ester | ||||
| TCMBANKIN023881 | Decyl methacrylate | C14H26O2 | 226.35 g/mol | CCCCCCCCCCOC(=O)C(=C)C | |
| TCMBANKIN023884 | dodecane,5-cyclohexyl- | C18H36 | 252.5 g/mol | CCCCCCCC(CCCC)C1CCCCC1 | |
| TCMBANKIN025358 | benzoic acid | Benzoic acid, 2-[(carboxymethyl)amino]-4-chloro-; 2-[(carboxymethyl)amino]-4-chlorobenzoic acid; DTXSID70455462; BG00311790; AC-17987; AX8062950; 2-carboxymethylamino-4-chlorobenzoic acid; KB-223858; AK140629; 99282-79-8; benzoicacid; CTK5I0315; 2-(Carboxymethyl-amino)-4-chloro-; AKOS015963713; SCHEMBL3236365; 2-(carboxymethylamino)-4-chlorobenzoic acid; benzoic acid ; 2-(CARBOXYMETHYL-AMINO)-4-CHLORO-BENZOIC ACID; AJ-79604; 2-((Carboxymethyl)amino)-4-chlorobenzoic acid; UDXGKLGUAJLLCJ-UHFFFAOYSA-N; ZINC21988796 | C7H6O2 | 122.12 | C1=CC(=C(C=C1Cl)NCC(=O)O)C(=O)O |
| TCMBANKIN027702 | Citrusin B | SCHEMBL7641595; 3-[3-Methoxy-4-[(beta-D-glucopyranosyl)oxy]phenyl]-2-[2,6-dimethoxy-4-[(E)-3-hydroxy-1-propenyl]phenoxy]-1,3-propanediol; citrusin B; citrusin b; 105279-10-5 | C27H36O13 | 568.57 | COC1=CC(=CC(=C1OC(CO)C(C2=CC(=C(C=C2)OC3C(C(C(C(O3)CO)O)O)O)OC)O)OC)C=CCO |
| TCMBANKIN028345 | 9,12,15-octadecatrien-l-ol | ||||
| TCMBANKIN029112 | 2-monostearin | C21H42O4 | 358.6 g/mol | CCCCCCCCCCCCCCCCCC(=O)OC(CO)CO | |
| TCMBANKIN029613 | z-2-octadecene-l-ol | ||||
| TCMBANKIN029960 | 4-ketopinores | 372.4 | |||
| TCMBANKIN030305 | monoacetin | C5H10O4 | 134.13 g/mol | CC(=O)OCC(CO)O | |
| TCMBANKIN032547 | cis-3,7-Dimethyl-2,6-octadiena | ||||
| TCMBANKIN034198 | acetic acid | AI3-02394; NSC132953; Azijnzuur [Dutch]; Acido acetico [Italian]; Essigsaeure [German]; InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4; Pyroligneous acid; CARBOXYMETHYL GROUP; Caswell No. 003; 45727_FLUKA; A8976_SIAL; A6283_SIAL; 64-19-7; BRN 0506007; 318590_ALDRICH; 45730_FLUKA; 77671-22-8; cellulose diacetate; Acetic acid solution, with more than 10% and less than 50% acid, by mass [UN2790] [Corrosive]; 9035-69-2; 49199_FLUKA; Cellulose diacetate [USAN]; Cellulose, diacetate; FEMA Number 2006; W200611_ALDRICH; CBM; 320099_SIAL; Methanecarboxylic acid; 45726_FLUKA; NCIOpen2_000682; Glacial acetic acid; Acetic acid (JP15/NF); ethanoic acid; 207004-55-5; Otic Tridesilon; 40209_RIEDEL; Acetic acid, propionic acid distillate; NSC406306; 537020_SIAL; 45725_FLUKA; WLN: QV1; LS-2535; Acetic acid, glacial; 27225_RIEDEL; Ethylic acid; AKOS006290339; 07692_FLUKA; ACY; NSC 132953; ACT; 33206_RIEDEL; EPA Pesticide Chemical Code 044001; 380121_SIAL; W200603_ALDRICH; Acetic acid, glacial (USP); ethoic acid; Acetic acid, glacial or acetic acid solution, >80% acid, by mass [UN2789] [Corrosive]; 34254_RIEDEL; 4-02-00-00094 (Beilstein Handbook Reference); 46928_SUPELCO; Acido acetico; C00033; Acetasol (TN); Acetic acid solution, not less than 50% but more than 80% acid, by mass [UN2790] [Corrosive]; Carboxylic acids, C2-3; CHEBI:15366; Acetic acid, of a concentration of more than 10 per cent, by weight, of acetic acid; 45732_FLUKA; Acetic acid [JAN]; Octowy kwas [Polish]; Essigsaeure; Vinegar acid; 242853_SIAL; Glacial acetic acid (JP15); 38050_RIEDEL; A9967_SIAL; LS-1541; 38051_RIEDEL; Kyselina octova [Czech]; ST5213882; Acetate standard for IC; 33209_RIEDEL; UN2790; 40273_RIEDEL; Azijnzuur; Acetic acid solution; Acetic acid (natural); D00010; LMFA01010002; 27218_RIEDEL; Acetic acid, aqueous solution; HSDB 40; 68475-71-8; 34255_RIEDEL; NCIOpen2_000659; 34256_RIEDEL; FEMA No. 2006; CCRIS 5952; Acide acetique; Acetic acid, diluted; Acetasol; Octowy kwas; 71251_FLUKA; 338826_SIAL; EINECS 200-580-7; 13669_FLUKA; Acide acetique [French]; CH3-COOH; 45754_FLUKA; 157090-22-7; Acetic acid, water solutions; UN2789 | C5H10O3 | 118.13 | CC(=O)NCCC1=CN(C2=C1C=C(C=C2)OC)C(=O)C3=CC=C(C=C3)Cl |
| TCMBANKIN036072 | 5-ethyl-cyclopent-1-enyl-methanol | ||||
| TCMBANKIN036901 | myristic acid | 1-Tridecanecarboxylic acid; Myristinsaeure; CH3-[CH2]12-COOH; 70079_FLUKA; AI3-15381; LMFA01010014; CH3-[CH2]12-COO(-); NCGC00091068-02; Myristic acid-[9,10-3H]; C06424; Emery 655; myristic acid ; NSC 5028; 70082_FLUKA; C14 fatty acid; ST023797; W276405_ALDRICH; CCRIS 4724; Kortacid 1499; 3uev; TUNFSRHWOTWDNC-UHFFFAOYSA-M; Tetradecanoic acid; EINECS 250-924-5; n-Tetradecoic acid; 4-02-00-01126 (Beilstein Handbook Reference); Hydrofol acid 1495; MYR; BRN 0508624; Myristate; Myristic acid (natural); Tetradecanoate; LS-190125; Crodacid; Myristic acid (8CI); EINECS 208-875-2; Prifac 2942; Myristic acid; AIDS002505; tetradecoate; W276413_ALDRICH; FEMA No. 2764; HSDB 5686; Philacid 1400; CHEBI:28875; Edenor C 14; n-tetradecoate; 45184-05-2; myristicacid; tetradecoic acid; n-Tetradecanoic acid; M3128_SIGMA; AIDS-002505; Univol U 316S; Lead dimyristate; AC1N2PSK; NCGC00091068-01; neo-Fat 14; NSC5028; Tetradecanoic acid (9CI); Hystrene 9014; Myristic acid, pure; M4792_SIGMA; CHEBI:30807; n-Tetradecan-1-oic acid; WLN: QV13; 1-tetradecanecarboxylate; 32112-52-0; n-tetradecan-1-oate; 544-63-8 | C14H28O2 | 228.371 | C([H])([H])(C([H])([H])C([H])([H])C([H])([H])C([H])([H])C(O[H])=O)C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] |
| TCMBANKIN041272 | stearic acid | 4-02-00-01206 (Beilstein Handbook Reference); AIDS-049230; Emersol 871; 8039-52-9; 126539-56-8; stearic acid, ion(1-); D00119; octadecoic acid; Hydrofol Acid 150 (VAN); 134503-33-6; Fatty acids C16-18; 68937-76-8; Kam 2000; VLZ 200; Lunac S 98; Glycon S-80; Hy-phi 1205; Lunac YA; Pristerene 9429; Pristerene 4900; Octadecanoic acid (9CI); Hystrene 9718NF; Edenor FHTI; Cetylacetic acid; NAA 173; NSC 25956; Lunac S 90; S 30C S 30C (fatty acid); Neo-Fat 18-61; Dar-chem 14; NSC25956; Edenor HT-JG 60; Octadecanoate; 57485-56-0; Oktadekansaeure; S 300 (fatty acid); Unister NAA 180; Industrene 5016; Prisorine 3508; Hydrofol Acid 150; Hystrene 4516; G 270; Stearic Acid Cherry; Century 1230; 822-16-2 (SODIUM SALT); NCGC00091596-02; Glycon S-90; 85404-83-7; NCGC00091596-01; Stearic acid (JP15/NF); Hystrene 5016; Hy-phi 1303; Glycon S-70; C01530; Octadecansaeure; Neo-Fat 18-55; WO 2 (fatty acid); Pristerene 9559; SA 200; Century 1240; Stearic acid, pure; Sunfat 18S; WO 2; CHEBI:28842; Industrene 5016K; LS-2392; Kam 3000; BRN 0608585; Edenor ST 20; AIDS049230; Lunac 30; EINECS 273-087-8; Emersol 150; 175366_SIAL; 8039-54-1; Fatty acids, C16-20; stearicacid; Stearic acid ion(1-)salt; Stearic acid (8CI); Stearinsaeure; Emersol 153NF; Hydrofol acid 1855; 57-11-4; Lunac S 30; Hystrene T 70; Prisorine 3501; Haimaric MKH(R); Stearex Beads; Groco 55; Hystrene S-97; Neo-Fat 18-54; W303518_ALDRICH; Hydrofol acid 1655; Nonsoul SN 1 (*Sodium salt*); EINECS 200-313-4; 39390-61-9; Emersol 120; EPA Pesticide Chemical Code 079082; Lunac S 20; Octadecanoic acid, ion(1-); 8013-28-3; AI3-00909; Kortacid 1895; FEMA No. 3035; Hystrene S 97; 82497-27-6; Tegostearic 254; SNA-2000 (*Sodium salt*); 1-Heptadecanecarboxylic acid; AC1MHWEJ; STL280244; 27405_RIEDEL; Steric acid; Industrene 9018; Glycon dp; F 3 (lubricant); Hy-phi 1401; Lunac S 50; Emersol 132; Stearic acid, ion(1-) (8CI); CH3-[CH2]16-COO(-); acide octadecanoique; Groco 55l; 73297_FLUKA; Serfax MT 90; Stearic acid [USAN:JAN]; 8039-51-8; acide stearique; Kam 1000; Acidum stearinicul; InChI=1/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20; 8039-53-0; 17FA; Stearophanic acid; 8037-83-0; Hystrene 7018; FA 1655; Prisorine 3502; Nonsoul SK 1; Hydrofol Acid 1895; Lunac S 40; Stearic acid 50; 8023-06-1; 85679_FLUKA; HSDB 2000; n-Octadecanoate; 400JB9103-88; Glycon tp; Unimac 5680; Loxiol G 20; Stearate; 875D; Octadecanoic acid; Neo-Fat 18-53; octadecanoate (n-C18:0); Radiacid 0427; Emery 871; Vanicol; Vis-Plus; PD 185; EINECS 250-178-0; AKOS022105769; 646-29-7; Edenor ST 1; S 300; Caswell No. 801D; Selosol 920; Tegostearic 272; Isostearic acid EX; A 1760; WLN: QV17; Stearic acid (TN); Pearl stearic; 609343-71-7; Palmitic acid - stearic acid mixture; Emersol 875; Industrene 8718; Hystrene 9718NFFG; NCGC00164255-02; ST023799; LMFA01010018; Groco 54; Edenor C18; Hystrene T-70; Hy-phi 1199; CTK8J8420; n-Octadecanoic acid; Groco 58; Pristerene 4963; Formula 300; AFCO-Chem B 65; CCRIS 2305; Industrene R; Century 1220; S4751_SIGMA; Neo-Fat 18; 58392-66-8; Barolub FTA; Hystrene 9718; CH3-[CH2]16-COOH; STE; 8037-40-9; 30399-84-9; Lunac S 90KC; Hydrofol 1895; Emery 875D; Century 1210; QIQXTHQIDYTFRH-UHFFFAOYSA-M; Neo-Fat 18-59; LS-1388; Groco 59; Humko Industrene R; Hystrene 80; Adeka Fatty Acid SA 910; Stearic acid; Prifac 2918; Emersol 6349; Edenor C 18/98; 3uex; LS-97707; CHEBI:25629; Neo-Fat 18-S; Stearic acid - palmitic acid mixture; Tegostearic 255; C-Lube 10 | C18H36O2 | 284 | C([H])([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C(O[H])= O |
| TCMBANKIN044029 | heptadecanoic acid | Heptadecanoate carnitine; Carnitine heptadecanoic acid; Heptadecanoylcarnitine; 3-carboxy-N,N,N-trimethyl-2-[(1-oxoheptadecyl)oxy]-1-Propanaminium inner salt; CHEBI:131887; O-heptadecanoylcarnitine; LMFA07070067; 3-(heptadecanoyloxy)-4-(trimethylazaniumyl)butanoate; Heptadecanoyl carnitine; C17 carnitine; Carnitine heptadecanoate; SCHEMBL19182624; Heptadecanoyl acid carnitine | C17H34O2 | 270.451 | C([H])([H])(C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C(=O)O[H] |
| TCMBANKIN045916 | phytofluene | C40H62 | 543 | C(/C([H])([H])[H])(\C([H])([H])[H])=C([H])/C([H])([H])C([H])([H])\C(\C([H])([H])[H])=C([H])\C([H])([H])C([H])([H])\C(\C([H])([H])[H])=C([H])\C([H])=C([H])\C(\C([H])([H])[H])=C([H])\C([H])=C([H])/C([H] )=C(/C([H])([H])C([H])([H])\C([H])=C(\C([H])([H])C([H])([H])\C([H])=C(\C([H])([H])C([H])([H])\C(\C([H])([H])[H])=C([H])/C([H])([H])[H])/C([H])([H])[H])/C([H])([H])[H])\C([H])([H])[H] | |
| TCMBANKIN057142 | Ruvoside | UN2330; 1120-21-4; CAS-1120-21-4; LTBB002321; LS-158394; UN 2330; UNII-JV0QT00NUE; DSSTox_CID_1689; AI3-21126; U203; ACMC-209t6p; MolPort-001-783-218; Jsp000912; CCRIS 3796; Undecane [UN2330] [Flammable liquid]; EC 214-300-6; UND; undecyl group; 4-01-00-00487 (Beilstein Handbook Reference); KSC176C3J; Undecane; ANW-42095; 175476-97-8; DSSTox_RID_76285; AC1L23G2; n-Undecane, 99% 50g; Undekan; Undecane, 99%; QSPL 058; 17398EC4-D16F-42F6-8A27-60F8EC075469; BRN 1697099; Undecane, >=99%; TR-002350; InChI=1/C11H24/c1-3-5-7-9-11-10-8-6-4-2/h3-11H2,1-2H; UNDECAN-2-YL; MCULE-7319807036; NSC 66159; EINECS 214-300-6; J-002689; RSJKGSCJYJTIGS-UHFFFAOYSA-N; NCGC00254001-01; DTXSID9021689; n-C11H24; U0002; S0283; undecan; DSSTox_GSID_21689; SC-79237; CHEMBL132474; Undecane, analytical standard; JV0QT00NUE; MFCD00008959; Hendekan; HSDB 5791; CH3-[CH2]9-CH3; NCGC00247896-01; C-28174; CC-33184; N-UNDECANE; AKOS005145675; FT-0633353; AN-20593; 61193-21-3; 55101-35-4; KS-00000WJI; NSC66159; NSC-66159; I14-60624; ZINC1693211; Hendecane; Decane, methyl-; n-Hendecane; LMFA11000591; CHEBI:46342; TRA0090240; Undecane [UN2330] [Flammable liquid]; DB-041031; CTK0H6134; RTR-002350; Tox21_300076;LMFA11000001; Tridekan; InChI=1/C13H28/c1-3-5-7-9-11-13-12-10-8-6-4-2/h3-13H2,1-2H; CH3-[CH2]11-CH3; 629-50-5; 91490_FLUKA; 442713_SUPELCO; HSDB 5727; n-Tridecane; EINECS 211-093-4; NSC66205; T57401_ALDRICH; Tridecane; CHEBI:35998; NSC 66205; TRIDECANE, N-; C13834;Tridekan; UNII-114P5I43UJ component IIYFAKIEWZDVMP-UHFFFAOYSA-N; MCULE-7749861366; U393; DB-054344; Tridecane_GurudeebanSatyavani; ACMC-209t6w; C13H28; C13834; N-TRIDECANE; 757DB156-6441-49B0-A824-1532074AC0F6; NCGC00257175-01; IIYFAKIEWZDVMP-UHFFFAOYSA-N; Tridecane, >=99%; TL8004327; MolPort-003-933-018; LS-157141; AN-22061; STL301147; CAS-629-50-5; tridecan; LMFA11000001; SC-74775; AC1L1ZHL; LTBB002872; DSSTox_CID_7266; C-28190; InChI=1/C13H28/c1-3-5-7-9-11-13-12-10-8-6-4-2/h3-13H2,1-2H; Tridecane, 99.0%; TRA0008560; I14-59696; KSC353S8D; UNII-FW7807707B component IIYFAKIEWZDVMP-UHFFFAOYSA-N; S0285; Dodecane, methyl-; AKOS016011009; FT-0632663; Tridecane, analytical standard; Alkanes, C12-14; MFCD00008979; UNII-A3LZF0L939; DSSTox_GSID_27266; RT-000404; CHEMBL135694; tridecyl group; KS-00000XDT; ST24031950; HSDB 5727; EINECS 211-093-4; AC1Q28TY; DSSTox_RID_78377; FT-0082500; DTXSID6027266; CC-33178; A3LZF0L939; Tox21_303043; NSC-66205; Tridecane; CH3-[CH2]11-CH3; CTK2F3981; TRD; EC 211-093-4; NSC66205; AK115985; ANW-42102; 629-50-5; CHEBI:35998; NSC 66205; TRIDECANE, N-; ZINC1693738;n-tridecane;TRD | C30H46O9 | [C@]1([H])(OC([H])([H])[H])[C@@]([H])(O[H])[C@]([H])(C([H])([H])[H])O[C@@]([H])(O[C@@]2([H])C([H])([H])[C@]3([H])[C@@](C([H])([H])O[H])([C@@]([H])(C([H])([H])C([H])([H])[C@](C([H])([H])[H])([C@]([H])( C4=C([H])C(=O)OC4([H])[H])C([H])([H])C5([H])[H])[C@]56O[H])[C@@]6([H])C([H])([H])C3([H])[H])C([H])([H])C2([H])[H])[C@@]1([H])O[H] | |
| TCMBANKIN057964 | Immune globulin from;gaba;γ-aminobutyricacid;aminobutyric acid | γ-aminobutyric acid | C4H9NO2 | C(CC(=O)O)CN | |
| TCMBANKIN057966 | CIR | C00327; EINECS 206-759-6; (2S)-2-amino-5-(carbamoylamino)pentanoic acid; (2S)-2-amino-5-ureidopentanoic acid; C7629_SIGMA; (2S)-2-amino-5-ureido-pentanoic acid; Citrulline, L-; alpha-Amino-delta-ureidovaleric acid; NSC 27425; (2S)-2-amino-5-(aminocarbonylamino)pentanoic acid; Ornithine, N5-(aminocarbonyl)-; N5-(Aminocarbonyl)ornithine; Ornithine, N5-carbamoyl-, L- (8CI); N(5)-(aminocarbonyl)-L-ornithine; SBB012374; N(delta)-Carbamylornithine; N(5)-carbamoyl-L-ornithine; (2S)-2-amino-5-ureido-valeric acid; (S)-2-Amino-5-ureidopentanoic acid; SMP1_000146; 2-Amino-5-ureidovaleric acid; NCGC00142602-01; L-2-Amino-5-ureidovaleric acid; delta-Ureidonorvaline; CHEBI:16349; citrulline; AB1007188; AC1LCUKE; d-citrullin; AK-58500; (R)-2-Amino-5-ureidopentanoic acid; MFCD00216469; KB-49607; D-Citruline; AX8031821; D-Ornithine,N5-(aminocarbonyl)-; W-204205; H-D-Orn(carbamoyl)-OH; (2R)-5-(aminocarbonylamino)-2-azanyl-pentanoic acid; DTXSID90348463; MolPort-003-928-964; 594C519; H-D-Cit-OH; D-Citrulline, >=99.0%; CTK4C0068; N(5)-carbamoyl-D-ornithine; AmbotzHAA1014; AJ-33795; AB0012765; ST24035348; ACM13594520; D-Citrulline; A807006; PubChem17499; TC-108738; J-300336; CHEBI:49007; SC-10122; C6H13N3O3; SCHEMBL437142; ANW-19993; AM82460; AS-12983; GTPL4683; ZINC2166829; FT-0659369; 13594-51-9; B-7191; D0V2DT; (2R)-2-amino-5-(carbamoylamino)pentanoic acid | C6H13N3O3 | 175.19 g/mol | C(CC(C(=O)O)N)CNC(=O)N |
| TCMBANKIN057986 | EG | NSC35747; 81310_FLUKA; Glycol, polyethylene (600); c0542; Sentry polyox WSR (TN); 73034_FLUKA; 1,2-ETHANEDIOL (GLYCOL); 02393_FLUKA; 95172_FLUKA; Carbowax 300; 03747_FLUKA; 81180_FLUKA; Methoxypolyethylene glycol; NSC 93876; 202487_ALDRICH; 03468_FLUKA; P4338_SIAL; 81202_FLUKA; Polyethylene glycol, diglycidyl bisphenol A polymer; Polyethylene glycol compound; 81288_FLUKA; 293237_ALDRICH; P0694_SIAL; 372811_ALDRICH; CCRIS 3744; 637726_ALDRICH; Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy-; 44101_FLUKA; 81292_FLUKA; 146AR; 181986_ALDRICH; D06424; M.e.g.; Methoxy poly(ethylene glycol); CHEBI:30742; 81294_FLUKA; 81190_FLUKA; 03469_FLUKA; Macrogol 400 (TN); NSC32853; 37225-26-6; AIDS017549; 81272_FLUKA; 81208_FLUKA; NCGC00091510-01; Ethylene glycol; 372838_ALDRICH; Macrogol 6000 (JP15); Ethane-1,2-diol; 81162_FLUKA; Ethylene dihydrate; NSC152325; P7181_SIGMA; Solbanon (TN); 81210_FLUKA; 03465_FLUKA; 182028_ALDRICH; 81298_FLUKA; 03466_FLUKA; 87006_FLUKA; NSC32856; Union Carbide XL 54 Type I De-icing Fluid; Carbowax 1540; 81260_FLUKA; Lutrol E (TN); Polyethylene oxide; 95904_FLUKA; 81304_FLUKA; Caswell No. 441; 03463_FLUKA; 17738_FLUKA; 81170_FLUKA; Macrogol 1500 (JP15); P4463_SIAL; 81268_FLUKA; 85978_FLUKA; NSC57859; 03997_FLUKA; 71578_FLUKA; PEG 3600; Macrogol (JP15); P5413_SIAL; 81296_FLUKA; Glycol, polypropylene (P750); NCI-C00920; D06422; M6768_SIGMA; P3515_SIGMA; 202436_ALDRICH; 90878_FLUKA; Polyethylene glycol 200; D06423; 88440_FLUKA; NSC35749; 182001_ALDRICH; Ucar 17; DuPont Zonyl FSO Fluorinated Surfactants; 71767-64-1; Polyethylene oxide (NF); NCIOpen2_002100; Fridex; 87333_FLUKA; P3640_SIGMA; 81172_FLUKA; 88276_FLUKA; 372803_ALDRICH; Lutrol E; Glycol, polypropylene (P400); NSC35748; 03395_FLUKA; P1458_SIAL; Tescol; P7777_SIGMA; 03473_FLUKA; Poly(ethylene glycol) methyl ether; 84184_FLUKA; P2263_SIGMA; DuPont Zonyl FSE Fluorinated Surfactants; 373001_ALDRICH; Macrogol 6000 (TN); 81150_FLUKA; Lutrol-9; NSC32855; NSC35746; POLYETHYLENE GLYCOL; InChI=1/C2H6O2/c3-1-2-4/h3-4H,1-2H; A-GLYCOL; 81201_FLUKA; Macrogol 1500 (TN); 324558_ALDRICH; 81284_FLUKA; Methoxypolyethylene glycol 350; 81289_FLUKA; NSC35745; 107-21-1; 81160_FLUKA; Carbowax 4000; 83272_FLUKA; ethanediol; 94646_FLUKA; D03370; 81323_FLUKA; 03461_FLUKA; 202371_ALDRICH; Undecaethylene glycol; 81293_FLUKA; Polyethylene glycol/Polyethylene oxide standard ReadyCal set Mp 500-2'740'000; 202495_ALDRICH; D06418; 1,2-Dihydroxyethane; HO-CH2-CH2-OH; 83271_FLUKA; 2219-51-4; AI3-03050; Macrogol 1500; C15588; Zerex; D06419; 81280_FLUKA; C01380; 89782_FLUKA; P7306_SIGMA; NSC93876; 202401_ALDRICH; 81269_FLUKA; Lutrol 9; 372773_ALDRICH; P6644_SIAL; 03394_FLUKA; EGL; 81206_FLUKA; Polyethylene glycol 3'000 monodispers solution; 03467_FLUKA; 33068_RIEDEL; 81275_FLUKA; Dowtherm SR 1; 76293_FLUKA; 55235_FLUKA; P6667_SIAL; 202509_ALDRICH; 189464_ALDRICH; NSC155081; D06420; 81205_FLUKA; HSDB 5012; 81221_FLUKA; 81212_FLUKA; Polyethylene oxide Standard 10'000; EPA Pesticide Chemical Code 042203; Glycol, ethylene-; 81213_FLUKA; 81187_FLUKA; Macrogol; 92897_FLUKA; Macrogol 6000; Carbowax 6000; 81227_FLUKA; 81209_FLUKA; 372994_ALDRICH; 81290_FLUKA; 81253_FLUKA; 81200_FLUKA; Dowtherm 4000; Poly(ethylene oxide); P3265_SIGMA; P3015_SIAL; 81242_FLUKA; 309028_ALDRICH; mono-Methyl polyethylene glycol; 372781_ALDRICH; P5402_SIAL; 81300_FLUKA; D06421; Glycol, polyethylene (400); 81230_FLUKA; Carbowax 400; 1,2-ethanediol; EDO; 03770_FLUKA; EINECS 203-473-3; 189472_ALDRICH; ZINC05224354; PEG 400; Sentry polyox WSR; Polyethylene glycol solution; Solbanon; PEG solution; Polyethylene glycol (NF); 81291_FLUKA; monoethylene glycol; Macrogol 400 (JP15); Macrogol 4000 (TN); 181994_ALDRICH; 202452_ALDRICH; Athylenglykol; PEG 600; 03464_FLUKA; NCIOpen2_002019; mono-Methyl polyethylene glycol 350; ST5214442; 91893_FLUKA; Macrogol 20000; NSC152324; 81282_FLUKA; 189456_ALDRICH; WLN: Q2Q; 295906_ALDRICH; 102466_ALDRICH; 81240_FLUKA; 1,2-Ethandiol; 37221-95-7; Macrogol 400; MPEG; 81396_FLUKA; 202444_ALDRICH; Oxirane, 2,2'-((1-methylethylidene)bis(4,1-phenyleneoxymethylene))bis-, polymer with alpha-hydro-omega-hydroxypoly(oxy-1,2-ethanediyl); 89510_FLUKA; 81214_FLUKA; Poly(ethylene glycol); Macrogol 4000 (JP15); 202398_ALDRICH; NSC32854; P2906_SIGMA; Polyethyleneglycol Bisphenol A Epichlorohydrin Copolymer; Carbowax 1000; 81286_FLUKA; 2-hydroxyethanol; 03462_FLUKA; 81287_FLUKA; 81188_FLUKA; Norkool; 84797_FLUKA; GLYCOL; 81283_FLUKA; P2139_SIAL; 96699_FLUKA; Macrogol 400 BPC; Ethylene alcohol; 81255_FLUKA; Glycol, polyethylene; 86101_FLUKA; Aethylenglykol [German]; Polyethylene glycol standard set Mp 400-40'000; 03557_FLUKA; Glycol, polypropylene (P1200); 81285_FLUKA; NCIOpen2_001979; Macrogol 20000 (JP15); Polyethylene glycol monomethyl ether; Glycol alcohol; 81189_FLUKA; ethylene-glycol; AIDS-017549; 25322-68-3; glycol | (C2H4O)nH2O (n = number of ethylene oxide units corresponding to a molecular weight of 6 000, about 140); C2H6O2 | 62.07 g/mol | C(CO)O |
| TCMBANKIN058306 | cinnamic acid | Cinnamic acid, (Z)-; trans-beta-Carboxystyrene; (Z)-3-phenylprop-2-enoate; Cinnamylic acid; trans-Zimtsaeure; Benzenepropenoic acid; Zimtsaeure; cinnamic acid ; 3-phenylprop-2-enoic acid; C80857_ALDRICH; 102-94-3; 133760_ALDRICH; AIDS-017619; tert-.beta.-Phenylacrylic acid; BRN 1905952; STK286093; InChI=1/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11; CCRIS 3190; NSC174025; 3-Phenylpropenoic acid; CHEBI:35700; W228818_ALDRICH; cinnamicacid; (E)-3-Phenyl-2-propenoic acid; 4-09-00-02002 (Beilstein Handbook Reference); NSC623441; AC1OAGPW; 140-10-3; Benzylideneacetic acid; NSC44010; Zimtsaeure [German]; 2-Propenoic acid, 3-phenyl-, (E)-; 3-Phenyl-2-propenoic acid; NSC9189; 2-Propenoic acid, 3-phenyl-, (Z)-; trans-3-Phenylacrylic acid; C10438; W228826_ALDRICH; Cinnamic acid, (E)-; WLN: QV1U1R; NCGC00165979-01; NSC 44010; CHEBI:27386; (2Z)-3-phenylacrylate; trans-Cinnamic acid; (Z)-Cinnamic acid; (2E)-3-phenylprop-2-enoic acid; Acidum cinnamylicum; (2E)-3-phenyl-2-propenoic acid; 621-82-9; cis-.beta.-Carboxystyrene; PHENYLETHYLENECARBOXYLIC ACID; EINECS 210-708-3; 2-Propenoic acid, 3-phenyl-; 3-Phenylacrylic acid; CHEBI:35697; EINECS 205-398-1; cis-Cinnamic acid; BRN 0507757; C00423; (2Z)-3-phenylprop-2-enoate; Kyselina skoricove [Czech]; Phenylacrylic acid; Cinnamic acid; Cinnamic acid (natural); (E)-3-phenylacrylic acid; cis-cinnamate; AI3-00891; (2E)-3-phenylacrylic acid; Allocinnamic acid; (E)-3-phenylprop-2-enoic acid; (E)-Cinnamic acid; beta-phenylacrylic acid; AIDS017619; trans-Cinnamate; trans-.beta.-Carboxystyrene; trans-3-Phenyl-2-propenoic acid; 96340_FLUKA; FEMA No. 2288; trans-3-Phenylpropensaeure; NSC 9189; Isocinnamic acid; AI3-23709; cis-Cinnamic acidanion; E-cinnamicacid; E-cinnamic acid; E- cinnamicacid; 3-Phenylpropenoic acid | C9H8O2 | 148.16 | C1=CC=C(C=C1)C=CC(=O)O |
| TCMBANKIN059230 | isovalericacid | LS-2386; ST5213941; Iva; Butanoic acid , 3-methyl-; Butyric acid, 3-methyl-; Kyselina isovalerova [Czech]; W310212_ALDRICH; Isobutyl formic acid; beta-Methylbutyric acid; 92634-50-9; 503-74-2; CHEBI:28484; WLN: QV1Y1&1; EINECS 207-975-3; 3-Methylbutyrate; isovaleric acid; METHYLBUTANOIC ACID; 4-02-00-00895 (Beilstein Handbook Reference); InChI=1/C5H10O2/c1-4(2)3-5(6)7/h4H,3H2,1-2H3,(H,6,7; NSC62783; Isovaleric acid (natural); 3-Methylbuttersaeure; Delphinic acid; 129542_ALDRICH; AI3-24132; NSC 62783; Butanoic acid, 3-methyl-, (R)-; FEMA Number: 3102; 3-methyl-butanoic acid; Acetic acid, isopropyl-; Isovaleriansaeure; 3-Methylbutyric acid; C08262; 3,4-Diisovaleryl adrenaline; HSDB 629; Isovalerianic acid; .beta.-Methylbutyric acid; BRN 1098522; 59850_FLUKA; Isopropylacetic acid; LMFA01020181; Isobutylformic acid; FEMA No. 3102; Isovaleric acid; Butanoic acid, 3-methyl-; W310204_ALDRICH; Isopentanoic acid; Isovalerianic; 35915-22-1; 3-Methylbutanoic acid | C5H10O2 | 102.13 g/mol | CC(C)CC(=O)O |
| TCMBANKIN059240 | Isovaleral | Aldehyde isovalerianique [French]; Isopentanal; beta-Methylbutanal; 2-Methylbutanal-4; C07329; 3-Methyl butyraldehyde; 3-Methylbutanal; Isovaleric aldehyde; 1-Butanal, 3-methyl-; Isopentaldehyde; W269212_ALDRICH; Isoamyl aldehyde; WLN: VH1Y1&1; 4-01-00-03291 (Beilstein Handbook Reference); 59820_FLUKA; Butanal, 3-methyl-; beta-Methylbutyraldehyde; InChI=1/C5H10O/c1-5(2)3-4-6/h4-5H,3H2,1-2H; .beta.-Methylbutanal; 3-Methylbutylaldehyde; 590-86-3; EINECS 209-691-5; 3-Methylbutyraldehyde (natural); NSC 404119; BRN 0773692; Butanal, methyl-; CCRIS 2945; NSC404119; Isoamylaldehyde; ZINC00896832; iso-C4H9CHO; W269204_ALDRICH; FEMA No. 2692; AI3-16106; HSDB 628; Isovalerylaldehyde; 3-Methylbutan-1-al; 3-Methylbutyraldehyde; 146455_ALDRICH; CHEBI:16638; 3-Methyl-1-butanal; 26140-47-6; Isovaleraldehyde; Butyraldehyde, 3-methyl-; Butanal,- methyl-; Butanal, 3- methyl-; isovaleraldehyde; 3-methyl butanal | C5H10O | 86.13 | CC(C)CC=O |
| TCMBANKIN059253 | Hexahydro-farnesyl acetone | hexahydro-farnesylacetone; 6,10,14-trimethyl-2-pentadecanone; 6, 10, 14-trimethyl-2-pentadecanone; (6S,10S)-6,10,14-trimethylpentadecan-2-one; 2-pentadecanone,6,10,14-trimethyl-; phytone; 6,10,14-TRIMETHYL-2-PENTADECANONE; hexahydro-farnesyl-acetone; 6,10,14-trimethyl-pentadecan-2-one; C-25231; MFCD00065420; ST049442; 13955-74-3; 2-pentadecanone, 6,10,14-trimethyl; 502-69-2; MCULE-5164481361; AC1Q5H6P; PHYTONE; 6,10,14-Trimethylpentadeca-2-one; 6,10,14-trimethyl pentadecan-2-one; STK761211; OR13502; AN-21434; CTK4J2356; MolPort-001-758-493; (R,R)-Phytone; ZX-AT021772; 2-Pentadecanone,6,10,14-trimethyl-; Hexahydrofarnesyl acetone; 6,10,14-trimethyl-2-pentadecanon; Fitone; AKOS016347358; Hexahydrofarnezylacetone; SBB012620; ZERO/001268; CC-29299; Hexahydrofarnesylacetone; 36116P; 2-Pentadecanone, 6,10,14-trimethyl-; 6,10,14-trimethyl-pentadecane-2-one; W-109084; SCHEMBL716506; Phytol ketone; AKOS001727037; SR-01000526355-1; FT-0632240; SR-01000526355; KB-85744; 6,10,14-Trimethylpentadecan-2-one; hexahydrofarnesylacetone; WHWDWIHXSPCOKZ-UHFFFAOYSA-N; EINECS 207-950-7; AC1L1V4Z; hexahydrofarnesylacetone; 6,10,14-trimethyl-2-pentadecanone; 6,10,14-trimethyl-2-Pentadeeanone; hexahydrofarnesyl acetone; 6,10,14-Trimethylpentadecan-2-one; 2-Pentadecanone, 6,10,14-trimethy-; 6, 10, 14- trimethyl- 2- pentadecanone; (6R,10R)-6,10,14-trimethylpentadecan-2-one; ZINC02169908; 6,10,14-trimethylpentadecan-2-one; 2-pentadecanone,6,10,14-trimethyl; Phytone; hexahydrofarnesyl acetone; perhydrofarnesyl acetone; FITONE | C18H36O | 268.5 g/mol | CC(C)CCCC(C)CCCC(C)CCCC(=O)C |
| TCMBANKIN059717 | beta-Cyclocitral | C10H16O | 152.23 g/mol | CC1=C(C(CCC1)(C)C)C=O | |
| TCMBANKIN059733 | methyltocols | C28H48O2 | 416.7 g/mol | CC1=C(C=C2CCC(OC2=C1C)(C)CCCC(C)CCCC(C)CCCC(C)C)O | |
| TCMBANKIN059841 | 2,4-Xylylaldehyde | C9H10O | 134.18 | CC1=CC(=C(C=C1)C=O)C | |
| TCMBANKIN059865 | D-delta-tocopherol | C27H46O2 | 402.65 | CC1=CC(=CC2=C1OC(CC2)(C)CCCC(C)CCCC(C)CCCC(C)C)O | |
| TCMBANKIN059955 | 2-methylnaphthalene | C11H10 | 142.2g/mol | CC1=CC2=CC=CC=C2C=C1 | |
| TCMBANKIN060028 | α-ionone | C13H20O | 192.3 g/mol | CC1=CCCC(C1C=CC(=O)C)(C)C | |
| TCMBANKIN060637 | D-2-Aminobutyrate | C4H9NO2 | 103.12g/mol | CCC(C(=O)O)N | |
| TCMBANKIN060727 | 4-ethylresorcinol | C8H10O2 | 138.16 g/mol | CCC1=C(C=C(C=C1)O)O | |
| TCMBANKIN060819 | 2-heptenal;E-2-Heptenal;cis-Hept-2-enal;trans-2-heptenal;(E)-2- heptenal;Heptenal;beta-heptenal;(Z)-2-heptenal;2- Heptenal,(E)-;alpha-heptenal | C7H12O | 112.17 g/mol | CCCCC=CC=O | |
| TCMBANKIN060853 | CHEBI:39932 | C8H16O | 128.21 | CCCCCC(C=C)O | |
| TCMBANKIN060888 | caproaldehyde | C6H12O | 100.16 g/mol | CCCCCC=O | |
| TCMBANKIN060891 | 2-Amyl furan | C9H14O | 138.21 g/mol | CCCCCC1=CC=CO1 | |
| TCMBANKIN060895 | γ-nonalactone | C9H16O2 | 156.22 g/mol | CCCCCC1CCC(=O)O1 | |
| TCMBANKIN060906 | trans-2-nonenal | C9H16O | 140.22 g/mol | CCCCCCC=CC=O | |
| TCMBANKIN060910 | cis-9-hexadecenoic acid | C16H30O2 | 254.41 g/mol | CCCCCCC=CCCCCCCCC(=O)O | |
| TCMBANKIN060918 | WLN: VH6 | C7H14O | 114.19 | CCCCCCC=O | |
| TCMBANKIN060958 | oleic acid;cis-oleic acid;oleinic acid | C18H34O2 | 282.46 | CCCCCCCCC=CCCCCCCCC(=O)O | |
| TCMBANKIN060960 | 2-Monoolein;beta-monoolein | C21H40O4 | 356.54 | CCCCCCCCC=CCCCCCCCC(=O)OC(CO)CO | |
| TCMBANKIN061004 | dodecanoic acid | C12H23O2- | 199.31 g/mol | CCCCCCCCCCCC(=O)[O-] | |
| TCMBANKIN061016 | tridecane | C13H28 | 184.36 g/mol | CCCCCCCCCCCCC | |
| TCMBANKIN061027 | n-tetradecane | C14H30 | 198.39 g/mol | CCCCCCCCCCCCCC | |
| TCMBANKIN061029 | myristic acid | C14H28O2 | 228.37 | CCCCCCCCCCCCCC(=O)O | |
| TCMBANKIN061043 | MYS | C15H32 | 212.41 | CCCCCCCCCCCCCCC | |
| TCMBANKIN061045 | PENTADECYLIC ACID | C15H30O2 | 242.4 g/mol | CCCCCCCCCCCCCCC(=O)O | |
| TCMBANKIN061058 | n-hexadecane | C16H34 | 226.44 g/mol | CCCCCCCCCCCCCCCC | |
| TCMBANKIN061065 | 2-Monopalmitin | C19H38O4 | 330.5 | CCCCCCCCCCCCCCCC(=O)OC(CO)CO | |
| TCMBANKIN061085 | n-heptadecane;heptadecane;Heptadekan | C17H36 | 240.5 g/mol | CCCCCCCCCCCCCCCCC | |
| TCMBANKIN061090 | n-octadecane;Oktadekan;octadecane | C18H38 | 254.49g/mol | CCCCCCCCCCCCCCCCCC | |
| TCMBANKIN061091 | stearic acid | CH3(CH2)16COOH | 284.5 g/mol | CCCCCCCCCCCCCCCCCC(=O)O | |
| TCMBANKIN061093 | ethyloctadecanoate | C20H40O2 | 312.5 g/mol | CCCCCCCCCCCCCCCCCC(=O)OCC | |
| TCMBANKIN061102 | LFA | C20H42 | 282.55 g/mol | CCCCCCCCCCCCCCCCCCCC | |
| TCMBANKIN061105 | Eicosanoic acid | C20H40O2 | 312.53 g/mol | CCCCCCCCCCCCCCCCCCCC(=O)O | |
| TCMBANKIN061111 | heneicosane | C21H44 | 296.57 | CCCCCCCCCCCCCCCCCCCCC | |
| TCMBANKIN061116 | n-docosane;TWT;docosane | C22H46 | 310.6 g/mol | CCCCCCCCCCCCCCCCCCCCCC | |
| TCMBANKIN061118 | behenic acid | C22H44O2 | 340.6 g/mol | CCCCCCCCCCCCCCCCCCCCCC(=O)O | |
| TCMBANKIN061122 | tricosane | C23H48 | 324.63 g/mol | CCCCCCCCCCCCCCCCCCCCCCC | |
| TCMBANKIN061127 | n-tetracosane | C24H50 | 338.65 | CCCCCCCCCCCCCCCCCCCCCCCC | |
| TCMBANKIN061161 | eicosanol;n-eicosanol | C20H42O | 298.55 | CCCCCCCCCCCCCCCCCCCCO | |
| TCMBANKIN061176 | Tridecanol | C13H28O; CH3(CH2)11CH2OH | 200.36 g/mol | CCCCCCCCCCCCCO | |
| TCMBANKIN061185 | 1-nonanol | C9H20O | 144.25 g/mol | CCCCCCCCCO | |
| TCMBANKIN061194 | 1-hexanol | C6H14O | 102.17 g/mol | CCCCCCO | |
| TCMBANKIN004019 | isolinderxide | ||||
| TCMBANKIN005216 | iaurolitsine | ||||
| TCMBANKIN015131 | linderoxide | C16H20O2 | 244.33 | CC12CC3=C(CC1C(=C)C4C2C4)C(=CO3)COC | |
| TCMBANKIN015367 | linderenonelinderol | ||||
| TCMBANKIN017107 | linderane | I07-0154; linderane ,98%; 476L250; MolPort-005-945-803; NP-013326; 13476-25-0; Linderane; CHEBI:6474; CHEMBL1079723; linderane(rg); C09495; ZINC898605; N1480; AKOS015896801 | C15H16O4 | 260.29 | CC1=CCCC23C(O2)C(C4=C(C1)OC=C4C)OC3=O |
| TCMBANKIN028008 | cucurbocitrin | 0 | |||
| TCMBANKIN032259 | linderol ester | ||||
| TCMBANKIN046503 | lindestrene | AC1NSXL4; SCHEMBL13772561; (8aS)-3,8a-dimethyl-5-methylidene-4,4a,6,9-tetrahydrobenzo[f][1]benzofuran | C15H18O | 214.3 | CC1=COC2=C1CC3C(=C)CC=CC3(C2)C |
| TCMBANKIN057966 | CIR | C00327; EINECS 206-759-6; (2S)-2-amino-5-(carbamoylamino)pentanoic acid; (2S)-2-amino-5-ureidopentanoic acid; C7629_SIGMA; (2S)-2-amino-5-ureido-pentanoic acid; Citrulline, L-; alpha-Amino-delta-ureidovaleric acid; NSC 27425; (2S)-2-amino-5-(aminocarbonylamino)pentanoic acid; Ornithine, N5-(aminocarbonyl)-; N5-(Aminocarbonyl)ornithine; Ornithine, N5-carbamoyl-, L- (8CI); N(5)-(aminocarbonyl)-L-ornithine; SBB012374; N(delta)-Carbamylornithine; N(5)-carbamoyl-L-ornithine; (2S)-2-amino-5-ureido-valeric acid; (S)-2-Amino-5-ureidopentanoic acid; SMP1_000146; 2-Amino-5-ureidovaleric acid; NCGC00142602-01; L-2-Amino-5-ureidovaleric acid; delta-Ureidonorvaline; CHEBI:16349; citrulline; AB1007188; AC1LCUKE; d-citrullin; AK-58500; (R)-2-Amino-5-ureidopentanoic acid; MFCD00216469; KB-49607; D-Citruline; AX8031821; D-Ornithine,N5-(aminocarbonyl)-; W-204205; H-D-Orn(carbamoyl)-OH; (2R)-5-(aminocarbonylamino)-2-azanyl-pentanoic acid; DTXSID90348463; MolPort-003-928-964; 594C519; H-D-Cit-OH; D-Citrulline, >=99.0%; CTK4C0068; N(5)-carbamoyl-D-ornithine; AmbotzHAA1014; AJ-33795; AB0012765; ST24035348; ACM13594520; D-Citrulline; A807006; PubChem17499; TC-108738; J-300336; CHEBI:49007; SC-10122; C6H13N3O3; SCHEMBL437142; ANW-19993; AM82460; AS-12983; GTPL4683; ZINC2166829; FT-0659369; 13594-51-9; B-7191; D0V2DT; (2R)-2-amino-5-(carbamoylamino)pentanoic acid | C6H13N3O3 | 175.19 g/mol | C(CC(C(=O)O)N)CNC(=O)N |
| TCMBANKIN060036 | neolinderalactone | C15H16O3 | 244.29 | CC1=CCCC2=CC(C3=C(C1)OC=C3C)OC2=O | |
| TCMBANKIN060053 | linderene | C15H18O2 | 230.3 g/mol | CC1=COC2=C1C(C3C(=C)C4CC4C3(C2)C)O | |
| TCMBANKIN060937 | linderic acid | C12H22O2 | 198.3 g/mol | CCCCCCCC=CCCC(=O)O | |
| TCMBANKIN023355 | alpha-amino-beta-(pyrazolyl-n)propionic acid | α-amino-β-(pyrazolyl-n)propionicacid | C6H9N3O2 | 155.15 g/mol | C1=CN(N=C1)CC(C(=O)O)N |
植物对应的疾病
| 疾病ID | 病名 | 疾病类型 | MeSH | 参考文献 |
|---|
植物对应的靶点
| 靶点ID | 基因名 | 基因别名 | 描述 | 染色体位置 | Map_Location | 基因类型 |
|---|
滇ICP备16009434号-1 |
Dai SX Lab