Plant Summary
Plant Information
TCMBank_ID: | TCMBANKHE002542 |
ID: | TCMBANKHE002542 |
植物拉丁名: |
|
功能与主治: | Treatment of chronic cough and asthma, nocturnal emission, spermatorrhea, enuresis, frequent urination, protracted diarrhea, spontaneous sweating, night sweating, impairment of body fluid with thirst, shortness of breath and feeble pulse, diabetes caused by internal heat, palpitation and insomnia./1. Its decoction exerts bacteriostatic effect on Pseudomonas aeruginosa (1:128), Staphylococcus aureus (1:64), Flexner's bacillus (1:32) and typhoid bacillus (1:8) in vitro.2. Schizandrin, one of its active components, can protect the liver from damage.3. Enhancing lymphocyte-blastogenesis rate.4. Cardiotonic and sedative. |
药用植物名: | 北五味 |
药用部位: | Schisandra chinensis (Turcz. ) Baill |
药味: | Warm; Sweet; Sour |
经络: | Lung; Heart; Kidney |
临床特征: | 1. Its decoction exerts bacteriostatic effect on Pseudomonas aeruginosa (1:128), Staphylococcus aureus (1:64), Flexner's bacillus (1:32) and typhoid bacillus (1:8) in vitro.2. Schizandrin, one of its active components, can protect the liver from damage.3. |
治疗类型: | 收涩 |
TCM_ID_id: | 5523 |
TCMSP_id: | 52 |
植物对应的化合物
| 化合物ID | 化合物名 | 别名 | 分子式 | 分子质量 | Smiles |
|---|
| TCMBANKIN001881 | Bosnyl acetate | ||||
| TCMBANKIN002330 | citronellyl acetate | AJ-33256; (-)-3,7-Dimethyloct-6-enyl acetate; 6-Octen-1-ol, 3,7-dimethyl-, 1-acetate, (3S)-; UNII-78RZL4H51H; Citronellol acetate, (S)-; (s)-citronellyl acetate; CJ-32447; 67601-05-2; CJ-07629; UNII-IZ420RT3OY component JOZKFWLRHCDGJA-NSHDSACASA-N; ZINC2040946; EINECS 266-767-0; [(3S)-3,7-dimethyloct-6-enyl] acetate; AC1OE5SZ; 6-Octen-1-ol, 3,7-dimethyl-, acetate, (3S)-; (?)-Citronellol acetate; 78RZL4H51H | C12H22O2 | 198.3 g/mol | CC(CCC=C(C)C)CCOC(=O)C |
| TCMBANKIN002615 | schisanlactone E | schisanlactone e | C30H44O4 | 468.67 | CC1=CCC(OC1=O)C(C)C2CCC3(C2(CCC45C3CCC(C4(C5)CCC(=O)O)C(=C)C)C)C |
| TCMBANKIN003366 | 2-isopropyl一8-methylphenanthrene一3,4一dione | ||||
| TCMBANKIN004095 | 2(1H)naphthal enone, 3, 5, 6, 7, 8, 8a-hexahydro-4, 8a-di m eth-yl-6-(1-m ethylethenyl)- | C15H22O | 218.33 g/mol | CC1=C2CC(CCC2(CC(=O)C1)C)C(=C)C | |
| TCMBANKIN005424 | 1H一yarozle,I,3一dimethyl | ||||
| TCMBANKIN006905 | alpha-amorphene | α-amorphene | C15H24 | 204.35 | |
| TCMBANKIN007143 | pentane,1一propoxy | ||||
| TCMBANKIN007728 | 5-(1-hydroxyethyl)-2,6-dihydroxy-1,7-dimethyl-9,10-dihydrophenanthrene | C18H20O3 | CC1=C(C(=C2C(=C1)CCC3=C2C=CC(=C3C)O)C(C)O)O | ||
| TCMBANKIN007999 | 24-methylenecyloartanone | C31H50O | 438.81 | ||
| TCMBANKIN008588 | manwuweizic acid | manwuweizicacid | C30H46O4 | 470.7 g/mol | CC(CCC=C(C)C(=O)O)C1CCC2(C1(CCC3=C2CCC(C3(C)CCC(=O)O)C(=C)C)C)C |
| TCMBANKIN009720 | 3,7,11-trimethyl-1-dodecanol | 1-dodecanol 3,7,11-trimethyl | C15H32O | 228.41 | CC(C)CCCC(C)CCCC(C)CCO |
| TCMBANKIN010629 | junipene | longifolene; (+)-longifolene | C15H24 | 204.35 | CC1(CCCC2(C3C1C(C2=C)CC3)C)C |
| TCMBANKIN011124 | β-himachalene | beta-himachalene | C15H24 | 204.35 g/mol | CC1=CC2C(=C(CCCC2(C)C)C)CC1 |
| TCMBANKIN012540 | α-terpipene | ||||
| TCMBANKIN013183 | α-himachalene | alpha-himachalene | C15H24 | 204.35 g/mol | CC1=CC2C(CC1)C(=C)CCCC2(C)C |
| TCMBANKIN013370 | Viridif lorol | viridiflorol | C15H26O | 222.37 g/mol | CC1CCC2C1C3C(C3(C)C)CCC2(C)O |
| TCMBANKIN014946 | Bicyclo(3.1.1)heptane,6,6一dimetliyl一3一methylene | ||||
| TCMBANKIN015655 | 3一Carene | ||||
| TCMBANKIN015777 | Benzene,1一metdyl一3一(1一methyle-thyl) | ||||
| TCMBANKIN016493 | Ylangene | C15H24 | 204.35 g/mol | CC1=CCC2C3C1C2(CCC3C(C)C)C | |
| TCMBANKIN016581 | neokadsuranic acid C | neokadsuranicacid c; neokadsuranic acid c; AC1NSZ1V; (Z)-6-[(11bS)-4,4,6b,11b-tetramethyl-10-methylidene-3-oxo-1,2,4a,5,6,7,8,9,10a,11-decahydrobenzo[a]fluoren-9-yl]-2-methylhept-2-enoic acid | C30H46O4 | 470.68 | CC(CCC=C(C)C(=O)O)C1CCC2(C(C1(C)O)CC3=C2CCC4C3(CCC(=O)C4(C)C)C)C |
| TCMBANKIN017368 | 2-(furan-2-yl)-S-(2,3,4-trihydroxybutyl)-1,4-diazine | ||||
| TCMBANKIN018770 | CycolPropane,1,1一dimethyl一2一(3一methl一1,3一butadienyl) | ||||
| TCMBANKIN019161 | selina-3,7(11)-diene | Selina-3,7(11)-diene | C15H24 | 204.35 g/mol | CC1=CCCC2(C1CC(=C(C)C)CC2)C |
| TCMBANKIN019349 | 2-nonanone | DTXSID2022125; FEMA No. 2785; 30642-09-2; Tox21_303845; TRA0044632; MFCD00009553; CAS-821-55-6; Heptyl methyl ketone; METHYL HEPTYL KETONE FCC; ACMC-209pnb; ANW-37509; 2- Nonanone; KSC220E7J; FT-0658401; 2-Nonanone, >=99%, FCC, FG; STL146543; 2-Nonanone, natural, >=97%, FCC, FG; N0293; 52000_FLUKA; 2-NONANONE; ST51047545; WLN: 7V1; Methyl heptyl ketone; ZE5K73YN2Z; W278505_ALDRICH; I14-4192; BG00600425; METHYL N-HEPTYL KETONE; KS-000011E9; A840259; NCGC00357115-01; VKCYHJWLYTUGCC-UHFFFAOYSA-N; NONANONE-2; RTR-025712; CHEMBL2228473; Nonanone; BBL011435; W278513_ALDRICH; AN-20502; Nonan-2-one; LS-2987; EINECS 212-480-0; UNII-ZE5K73YN2Z; AKOS005720803; SCHEMBL4089642; 63969_FLUKA; TR-025712; DSSTox_CID_2125; AS-10570; SCHEMBL626185; NSC-14760; .beta.-Nonanone; 2-Nonanone, >=99%; KB-25771; AC1L217X; ZINC1653216; AK325631; DSSTox_GSID_22125; Ketone, heptyl methyl; CHEBI:77927; NSC14760; n-HEPTYL METHYL KETONE; n-C7H15COCH3; 2-Nonanone (natural); NSC 14760; EN300-19772; MolPort-001-787-669; InChI=1/C9H18O/c1-3-4-5-6-7-8-9(2)10/h3-8H2,1-2H; 108731_ALDRICH; beta-Nonanone; RL05133; AC1Q2VVN; BRN 1743645; MCULE-9635928766; BB_SC-6918; LMFA12000052; SCHEMBL103970; SBB061540; 821-55-6; 2-Nonanone, analytical standard; NE10665; CTK1C0274 | C9H18O | 142.24 | CCCCCCCC(=O)C |
| TCMBANKIN019815 | beta-Gurjunene | (1aR-(1aalpha,4alpha,4abeta,7abeta,7balpha))-Decahydro-1,1,4-trimethyl-7-methylene-1H-cycloprop(e)azulene; 73464-47-8; beta-gurjunene; 1H-Cycloprop(e)azulene, decahydro-1,1,4-trimethyl-7-methylene-, (1aR-(1aalpha,4alpha,4abeta,7abeta,7balpha))-; β-gurjunene | C15H24 | 204.35 | CC1CCC2C(C2(C)C)C3C1CCC3=C |
| TCMBANKIN020929 | 3,3,7-trimethyl-11-methylene-spiro[5,5]undec-2-ene | ||||
| TCMBANKIN021279 | schizandrol B | C28H34O9 | 514.6 g/mol | CC=C(C)C(=O)OC1C2=CC(=C(C(=C2C3C(=CC(C1(C)O)C)C=C4C(=C3OC)OCO4)OC)OC)OC | |
| TCMBANKIN023256 | τ-gurjunene | ||||
| TCMBANKIN026021 | α- bulnesene | α-bulnesene | |||
| TCMBANKIN026323 | Hvdrazine,2一ethyl一1,1一dimerhyl | ||||
| TCMBANKIN026807 | alpha-ylangene | alpha-Ylangene; α-ylangene | C15H24 | 204.35 g/mol | CC1=CCC2C3C1C2(CCC3C(C)C)C |
| TCMBANKIN027592 | santolina triene | Santolinatriene | C10H16 | 136.23 | CC(=CC(C=C)C(=C)C)C |
| TCMBANKIN028609 | 12α-hydroxycoccinicacid | 12α--hydroxycoccinic acid | C20H30O3 | CC(C)C1=CC2=CCC3C(C2CC1O)(CCCC3(C)C(=O)O)C | |
| TCMBANKIN028769 | schisandroflorin | ||||
| TCMBANKIN029139 | a一Cubebene | ||||
| TCMBANKIN030556 | Bicyclo(3.1.1)heptane,6,6一dmjethyl一2一methylene | ||||
| TCMBANKIN031144 | Neokadsuranic acid B | neokadsuranic acid b; neokadsuranic acid B; neokadsuranicacid b | C30H44O3 | 452.7 g/mol | CC(CCC=C(C)C(=O)O)C1CCC2(C(C1=C)CC3=C2CCC4C3(CCC(=O)C4(C)C)C)C |
| TCMBANKIN033500 | a一CoPaene | ||||
| TCMBANKIN034198 | acetic acid | AI3-02394; NSC132953; Azijnzuur [Dutch]; Acido acetico [Italian]; Essigsaeure [German]; InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4; Pyroligneous acid; CARBOXYMETHYL GROUP; Caswell No. 003; 45727_FLUKA; A8976_SIAL; A6283_SIAL; 64-19-7; BRN 0506007; 318590_ALDRICH; 45730_FLUKA; 77671-22-8; cellulose diacetate; Acetic acid solution, with more than 10% and less than 50% acid, by mass [UN2790] [Corrosive]; 9035-69-2; 49199_FLUKA; Cellulose diacetate [USAN]; Cellulose, diacetate; FEMA Number 2006; W200611_ALDRICH; CBM; 320099_SIAL; Methanecarboxylic acid; 45726_FLUKA; NCIOpen2_000682; Glacial acetic acid; Acetic acid (JP15/NF); ethanoic acid; 207004-55-5; Otic Tridesilon; 40209_RIEDEL; Acetic acid, propionic acid distillate; NSC406306; 537020_SIAL; 45725_FLUKA; WLN: QV1; LS-2535; Acetic acid, glacial; 27225_RIEDEL; Ethylic acid; AKOS006290339; 07692_FLUKA; ACY; NSC 132953; ACT; 33206_RIEDEL; EPA Pesticide Chemical Code 044001; 380121_SIAL; W200603_ALDRICH; Acetic acid, glacial (USP); ethoic acid; Acetic acid, glacial or acetic acid solution, >80% acid, by mass [UN2789] [Corrosive]; 34254_RIEDEL; 4-02-00-00094 (Beilstein Handbook Reference); 46928_SUPELCO; Acido acetico; C00033; Acetasol (TN); Acetic acid solution, not less than 50% but more than 80% acid, by mass [UN2790] [Corrosive]; Carboxylic acids, C2-3; CHEBI:15366; Acetic acid, of a concentration of more than 10 per cent, by weight, of acetic acid; 45732_FLUKA; Acetic acid [JAN]; Octowy kwas [Polish]; Essigsaeure; Vinegar acid; 242853_SIAL; Glacial acetic acid (JP15); 38050_RIEDEL; A9967_SIAL; LS-1541; 38051_RIEDEL; Kyselina octova [Czech]; ST5213882; Acetate standard for IC; 33209_RIEDEL; UN2790; 40273_RIEDEL; Azijnzuur; Acetic acid solution; Acetic acid (natural); D00010; LMFA01010002; 27218_RIEDEL; Acetic acid, aqueous solution; HSDB 40; 68475-71-8; 34255_RIEDEL; NCIOpen2_000659; 34256_RIEDEL; FEMA No. 2006; CCRIS 5952; Acide acetique; Acetic acid, diluted; Acetasol; Octowy kwas; 71251_FLUKA; 338826_SIAL; EINECS 200-580-7; 13669_FLUKA; Acide acetique [French]; CH3-COOH; 45754_FLUKA; 157090-22-7; Acetic acid, water solutions; UN2789 | C5H10O3 | 118.13 | CC(=O)NCCC1=CN(C2=C1C=C(C=C2)OC)C(=O)C3=CC=C(C=C3)Cl |
| TCMBANKIN034693 | Bicyclo(3.1.1)hept一2一ene,3,6,6一trimethyl | ||||
| TCMBANKIN035217 | γ-curcumene | ||||
| TCMBANKIN036274 | bisabolene | Cyclohexene, 4-(1,5-dimethyl-4-hexen-1-ylidene)-1-methyl-; Bisabolene; 495-62-5; Cyclohexene, 4-(1,5-dimethyl-4-hexenylidene)-1-methyl-, (Z)-; 4-(1,5-Dimethyl-4-hexenylidene)-1-methylcyclohexene; UNII-E452K502K0; 2-Heptene, 2-methyl-6-(4-methyl-3-cyclohexen-1-ylidene)-, (Z)-; 6-Methyl-2-(4-methylcyclohex-3-enyl)hept-1,5-diene; 2-Heptene, 2-methyl-6-(4-methyl-3-cyclohexen-1-ylidene)- (7CI,8CI); Bisabolene (6CI); 2-Heptene, 2-methyl-6-(4-methyl-3-cyclohexen-1-ylidene)-; (1Z)-bisabola-1(10),4,7(11)-triene; 2-methyl-6-(4-methylcyclohex-3-enylidene)hept-2-ene; (4Z)-1-methyl-4-(6-methylhept-5-en-2-ylidene)cyclohexene; 1-Methyl-4-(1,5-dimethyl-4-hexenylidene)-1-cyclohexene; gamma-Bisabolen; (Z)-gamma-bisabolene; I14-60981; 1-Methyl-4-(6-methylhept-5-en-2-ylidene)cyclohex-1-ene; Cyclohexene, 4-(1,5-dimethyl-4-hexenylidene)-1-methyl-, (4Z)-; (Z)-.gamma.-Bisabolene; gamma-Bisabolene, (Z)-; FEMA No. 3331; LS-2584; LMPR0103060004; ST098717; EINECS 207-805-8; CHEBI:49238; bisabola-1(10),4,7(11)-triene; E452K502K0; Bisabolene (natural); 2-Methyl-6-(4-methyl-3-cyclohexen-1-ylidene)-2-heptene; (1Z)-bisabola-1(10),4,7(11)-triene (4Z)-4-(1,5-dimethylhex-4-en-1-ylidene)-1-methylcyclohexene; gamma-Bisabolene; XBGUIVFBMBVUEG-CCEZHUSRSA-N; ZINC30731544; Cyclohexene, 4-(1,5-dimethyl-4-hexen-1-ylidene)-1-methyl-, (4Z)-; (Z) gamma-bisabolene; C16814; (4Z)-4-(1,5-dimethylhex-4-en-1-ylidene)-1-methylcyclohexene; AKOS024287123; UNII-E6941S3U3Q component XBGUIVFBMBVUEG-CCEZHUSRSA-N; 11003-31-9; Limene; cis-gamma-Bisabolene; 13062-00-5; CHEBI:49237; (Z)-1-Methyl-4-(6-methylhept-5-en-2-ylidene)cyclohex-1-ene; ST50407046; 4-(1,5-dimethylhex-4-en-1-ylidene)-1-methylcyclohexene; AC1MHWGM; gamma-Bisabolene, (4Z)- | C15H24 | 204.35 g/mol | CC1=CCC(=C(C)CCC=C(C)C)CC1 |
| TCMBANKIN037150 | seco-neokadsuranic acid A | seco-neokadsuranicacid a | C30H44O4 | 468.7 g/mol | CC(CCC=C(C)C(=O)O)C1CCC2(C3CCC(C(C3=CC2C1=C)(C)CCC(=O)O)C(=C)C)C |
| TCMBANKIN037504 | β-Bisabolene | (1S)-bisabola-4,7(11),10(15)-triene; (-)-beta-bisabolene; beta-Bisabolene; Cyclohexene, 1-methyl-4-(5-methyl-1-methylene-4-hexenyl)-, (S)-; (S)-(-)-6-methyl-2-(4-methyl-3-cyclohexen-1-yl)-1,5-heptadiene; LMPR0103060013; beta-bisabolene ; β-Bisabolene; UNII-S19BRC22QA; (1S)-bisabola-4,7(11),10(15)-triene (4S)-1-methyl-4-(5-methyl-1-methylenehex-4-en-1-yl)cyclohexene; 1-Methyl-4-(5-methyl-1-methylene-4-hexenyl)-1-cyclohexene-, (4S)-; (4R)-1-methyl-4-(6-methylhepta-1,5-dien-2-yl)cyclohexene; S19BRC22QA; XZRVRYFILCSYSP-OAHLLOKOSA-N; InChI=1/C15H24/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6,8,15H,4-5,7,9-11H2,1-3H; CHEBI:49263; C19751; 1-methyl-4-(5-methyl-1-methylenehex-4-en-1-yl)cyclohexene; (4R)-1-methyl-4-(5-methyl-1-methylene-hex-4-enyl)cyclohexene; cyclohexene, 1-methyl-4-(5-methyl-1-methylene-4-hexenyl)-; FT-0622892; (-)-.beta.-bisabolene; .beta.-Bisabolene; 495-61-4; β- bisabolene; (+,-)-.beta.-Bisabolene; (-)-b-bisabolene,b-bisabolene,6-methyl-2-(4-methyl-3-cyclohexen-1-yl)-1,5-heptadiene; (4R)-1-methyl-4-(5-methyl-1-methylenehex-4-enyl)cyclohexene; l-beta-Bisabolene; l-.beta.-Bisabolene; (S)-1-Methyl-4-(5-methyl-1-methylene-4-hexenyl)cyclohexene; beta-bisabolene; (S)-beta-bisabolene; (4S)-1-methyl-4-(5-methyl-1-methylenehex-4-en-1-yl)cyclohexene; CHEMBL1077088; C16775; ZINC1846611; 1-Methyl-4-(5-methyl-1-methylene-4-hexenyl)-(S)-cyclohexene; (s)-1-methyl-4-(5-methyl-1-methylene-4-hexenyl)-cyclohexene; 1,5-Heptadiene, 6-methyl-2-(4-methyl-3-cyclohexen-1-yl)-, (S)-(-)- | 204.35 g/mol | ||
| TCMBANKIN037727 | Changnanic acid | changnanicacid | 468.67 | ||
| TCMBANKIN038187 | Gomisin J | AIDS-059281; (-)-Gomisin J; AIDS059281; gomisin j; 66280-25-9; Dibenzo(a,c)cyclooctene-3,10-diol, 5,6,7,8-tetrahydro-1,2,11,12-tetramethoxy-6,7-dimethyl-, stereoisomer; 6(S),7(R)-Dibenzo(a,c)cyclooctene-3,10-diol, 5,6,7,8-tetrahydro-1,2,11,12-tetramethoxy-6,7-dimethyl- | C22H28O6 | 388.45 | CC1CC2=CC(=C(C(=C2C3=C(C(=C(C=C3CC1C)O)OC)OC)OC)OC)O |
| TCMBANKIN038532 | δ-Cadinene | δ- cadinene | 204.39 | ||
| TCMBANKIN038603 | Schisanol | 454.7 g/mol | |||
| TCMBANKIN038710 | terpinyl acetate | TR-037878; KB-60724; ANW-37362; 2,6,6-TRIMETHYL-1,2-BIS({2,6,6-TRIMETHYLBICYCLO[3.1.1]HEPTAN-2-YL})BICYCLO[3.1.1]HEPTANE; ACETIC ACID; terpinylacetate; ACMC-1BKZH; AKOS015837978; RTR-037878; CTK3J2480; KSC492I8B | C32H54O2 | 470.8 g/mol | CC(=O)O.CC1(C2CCC(C1C2)(C)C3(CCC4CC3(C4(C)C)C5(CCC6CC5C6(C)C)C)C)C |
| TCMBANKIN039554 | hexanoic acid | (C6-C12) Alkylcarboxylic acid; n-Hexoic acid; BRN 0773837; Hexanoyl DL-carnitine; AC1O52RE; hexanoicacid; 142-62-1; Hexanoic acid (natural); n-Hexanoic acid; CCRIS 1347; Hexacid 698; 153745_ALDRICH; Hexanoic acid; 13476-79-4; 8040-17-3; 51109-46-7; AI3-07701; WLN: QV5; VVPRQWTYSNDTEA-UHFFFAOYSA-N; 19455-00-6; (C5-C9) Monobasic acids; Pentylformic acid; Hexanoyl-d,l-carnitine; Capronic acid; Butylacetic acid; Kyselina kapronova [Czech]; 4-02-00-00917 (Beilstein Handbook Reference); C01585; 1-Pentanecarboxylic acid; UN2829; 3-hexanoyloxy-4-(trimethylazaniumyl)butanoate; Fatty acids, C6-12; (C6-C12)Alkylcarboxylic acid; W255912_ALDRICH; NSC8266; CAPROIC ACID; CH3-[CH2]4-COOH; LMFA01010006; HEXANOIC ACID (CAPROIC ACID); n-Caproic acid; EINECS 267-013-3; CHEBI:30776; Hexanoylcarnitine; 68603-84-9; 70248-25-8; 21529_FLUKA; HSDB 6813; 3-(hexanoyloxy)-4-(trimethylazaniumyl)butanoate; Carboxylic acids, C5-9; NSC 8266; NCIOpen2_005355; LMFA07070070; 1-Propanaminium,3-carboxy-N,N,N-trimethyl-2-[(1-oxohexyl)oxy]-, chloride (1:1); EINECS 205-550-7; SCHEMBL235082; 1-Hexanoic acid; Pentanecarboxylic acid; Acid C-6; Carboxylic acids, C6-18 and C6-18-unsatd. mono- and C8-15-di-; H12137_ALDRICH; W255904_ALDRICH; 16571-42-9; Hexylic acid; AIDS212980; Caproic acid [UN2829] [Corrosive]; FEMA No. 2559; 67762-36-1; n-Hexylic acid; Hexoic acid; Pentiformic acid; EINECS 274-509-3; 6418-78-6; AIDS-212980; 53896-26-7; CTK4C6070; EINECS 271-676-4; Hexanoic acid ester with (3-carboxy-2-hydroxypropyl)trimethylammonium hydroxide inner salt; CHEBI:70749; InChI=1/C6H12O2/c1-2-3-4-5-6(7)8/h2-5H2,1H3,(H,7,8; O-hexanoylcarnitine; 1-Propanaminium, 3-carboxy-N,N,N-trimethyl-2-[(1-oxohexyl)oxy]-, inner salt; 3-(hexanoyloxy)-4-(trimethylammonio)butanoate | C6H12O2 | 116.158 | C(O[H])(=O)C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] |
| TCMBANKIN039983 | Schisanlactone A | schisanlactone a | 464.64 | ||
| TCMBANKIN040391 | Germacrene D | C16142; (1E,6E,8S)-8-isopropyl-1-methyl-5-methylenecyclodeca-1,6-diene; (1E,6E,8S)-8-isopropyl-1-methyl-5-methylene-cyclodeca-1,6-diene; germacrene-d; (-)-Germacrene D; (1E,6E,8S)-1-methyl-5-methylidene-8-propan-2-yl-cyclodeca-1,6-diene; germacrene d; Germacrene- D; GermacreneD; (1E,6E,8S)-1-methyl-5-methylidene-8-propan-2-ylcyclodeca-1,6-diene; nchembio.2007.29-comp4 | C15H24 | 204.351 | C1([H])([H])C(=C([H])[H])\C([H])=C([H])\[C@]([H])(C([H])(C([H])([H])[H])C([H])([H])[H])C([H])([H])C([H])([H])\C(\C([H])([H])[H])=C([H])\C1([H])[H] |
| TCMBANKIN040453 | anwuweizic acid | anwuweizicacid | C30H48O3 | 456.7 g/mol | CC(CCC=C(C)C(=O)O)C1CCC2(C1(CCC3=C2CCC4C3(CCC(C4(C)C)O)C)C)C |
| TCMBANKIN040532 | Kadsudilactone | 468.7 g/mol | |||
| TCMBANKIN040609 | Deoxyschizandrin | 416.5 g/mol | |||
| TCMBANKIN040783 | isoledene | C15H24 | 204.35 g/mol | CC1CCC2C(C2(C)C)C3=C1CCC3C | |
| TCMBANKIN040900 | Bornyl acetate | B0526; 5655-61-8; BORNYL ACETATE; ( )-Bornyl acetate; bornylacetate | 196.29 g/mol | ||
| TCMBANKIN041149 | Schisanlactone B | schisanlactone b | 466.7 g/mol | ||
| TCMBANKIN041920 | Kadsulactone | 452.67 | |||
| TCMBANKIN042068 | (24Z)-3-Oxo-12α-hydroxylanosta-8,24-dien-26-oic acid | (24z)-3-oxo-12α-hydroxylanosta-8,24-dien-26-oicacid | |||
| TCMBANKIN043322 | Kadsuric acid | kadsuricacid | 470.7 g/mol | ||
| TCMBANKIN044232 | schizandronic acid | schizandronicacid | C30H46O3 | 454.68 | CC(CCC=C(C)C(=O)O)C1CCC2(C1(CCC34C2CCC5C3(C4)CCC(=O)C5(C)C)C)C |
| TCMBANKIN045320 | (24Z)-7,24-Tirucalladien-3β,26-diol | ||||
| TCMBANKIN046165 | 12β-hydroxycoccinic acid | 12β-hydroxycoccinicacid | C30H46O4 | CC(CCC=C(C)C(=O)O)C1CCC2(C1(C(C=C3C2CCC4C3(CCC(=O)C4(C)C)C)O)C)C | |
| TCMBANKIN046249 | camphene | CHEMBL506889; CJ-04639; (-)-camphene; (-)-Camphene, technical grade, 75% (90% as camphene and fenchene); L-Camphene; DSSTox_RID_81702; (1S,4R)-2,2-dimethyl-3-methylenebicyclo[2.2.1]heptane; Bicyclo(2.2.1)heptane, 2,2-dimethyl-3-methylene-, (1S)-; (1S)-2,2-Dimethyl-3-methylenebicyclo(2.2.1)heptane; DSSTox_CID_26538; FCH1121419; (1S,4R)-2,2-dimethyl-3-methylidenebicyclo[2.2.1]heptane; 5794/4/7; C06305; (-) camphene; ZB015525; CC-00037; M5YAV509FN; UNII-G3VG94Z26E component CRPUJAZIXJMDBK-BDAKNGLRSA-N; DTXSID3046538; ZINC968230; CHEBI:89; (1S,4R)-camphene; (-)-Comphene; cam phene; DSSTox_GSID_46538; NCGC00166100-01; (-)-(1S,4R)-camphene; Bicyclo(2.2.1)heptane, 2,2-dimethyl-3-methylene-, (1S,4R)-; CAS-5794-04-7; EINECS 227-337-8; UNII-M5YAV509FN; CRPUJAZIXJMDBK-BDAKNGLRSA-N; (1S)-2,2-Dimethyl-3-methylenebicyclo[2.2.1]heptane; Tox21_112314 | C10H16 | 136.23 g/mol | CC1(C2CCC(C2)C1=C)C |
| TCMBANKIN046907 | 2-pentadecanone | CTK1A3861; W372404_ALDRICH; 2345-28-0; UNII-B2Q48J997N; 2-Pentadecanone, >=98.5%; CHEMBL3273567; I14-49263; AK-86074; SSV; DTXSID6062333; ST2419773; CJPNOLIZCWDHJK-UHFFFAOYSA-N; SCHEMBL336157; Methyl tridecyl ketone; KS-0000173E; ANW-25129; 2-Pentandecanone; J-015112; KB-174026; 2-PENTADECANONE; FEMA 3724; EINECS 219-064-8; Pentadecanone; AI3-11706; AN-19908; Pentadecan-2-one; ACMC-209g3f; AKOS009157795; RT-000810; MFCD00053712; AC1L1UYR; 2-Pentadecanone, analytical standard; P1063; LMFA12000056; ACM2345280; FEMA No. 3724; 2-Pentadecanone, >=98%, FG; FT-0613261; (3e,5e,7e,9e,11e,13e)-Pentadeca-3,5,7,9,11,13-Hexaen-2-One; AX8077970; B2Q48J997N; 1569AB; CHEBI:89254; ZINC1850860; MolPort-003-938-983; 76535_FLUKA | C15H30O | 226.4 | CCCCCCCCCCCCCC(=O)C |
| TCMBANKIN047589 | schisandrin B | C23H28O6 | 400.5 g/mol | CC1CC2=CC3=C(C(=C2C4=C(C(=C(C=C4CC1C)OC)OC)OC)OC)OCO3 | |
| TCMBANKIN047652 | Schisanlactone F | schisanlactone f | 468.7 g/mol | ||
| TCMBANKIN048149 | β-Sesquiphellandrene | beta-sesqui-phellandrene; b-sesquiphellandrene; beta-sesquiphellandrene; beta-Sesquiphellandrene; β- sesquiphellandrene; beta-sesquiphellandrene ; β-sesqui-phellandrene | 204.35 | ||
| TCMBANKIN048316 | Lancilactone B | 462.6 g/mol | |||
| TCMBANKIN048506 | β-Maaliene | [1aR-(1a.alpha.,3a.alpha.,7b.alpha.)]-1a,2,3,3a,4,5,6,7b- octahydro-1,1,3a,7-tetramethyl-1H-Cyclopropa[a]-naphthalene[1aR.(1a.alpha.,3a.alpha.,7ba)]; beta-maaliene; BETA-MAALIENE | 204.35 | ||
| TCMBANKIN049794 | coccinic acid | coccinicacid | C30H46O3 | CC(CCC=C(C)C(=O)O)C1CCC2(C1(CC=C3C2CCC4C3(CCC(=O)C4(C)C)C)C)C | |
| TCMBANKIN058659 | 12β-acetoxycoccinic acid | 12β-acetoxycoccinicacid | C32H48O5 | C32H48O5 | |
| TCMBANKIN058683 | 2-[(1R,3S,4S)-3-isopropenyl-4-methyl-4-vinylcyclohexyl]propan-2-ol | EINECS 211-360-5; 2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]propan-2-ol; 8024-27-9; AI3-00210; Cyclohexanemethanol, 4-ethenyl-alpha,alpha,4-trimethyl-3-(1-methylethenyl)-, (1R,3S,4S)-; Cyclohexanemethanol, 4-ethenyl-alpha,alpha,4-trimethyl-3-(1-methylethenyl)-, (1R-(1alpha,3alpha,4beta))-; 2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-yl-cyclohexyl]propan-2-ol; 639-99-6; Cyclohexanemethanol, 4-ethenyl-alpha,alpha,4-trimethyl-3-(1-methylethenyl)-, (1theta-(1alpha,3alpha,4beta))-; 2-[(1R,3S,4S)-3-isopropenyl-4-methyl-4-vinyl-cyclohexyl]propan-2-ol; (1S,2S,4R)-(-)-alpha,alpha-Dimethyl-1-vinyl-o-menth-8-ene-4-methanol;Elemol;elemol; GFJIQNADMLPFOW-GUTXKFCHSA-N; [1R-[1.alpha.,3.alpha.,4.beta.]]-4-Ethenyl-.alpha.,.alpha.,4-trimethyl-3-[1-methylethenyl]cyclohexanemethanol | C15H26O | 222.37 | CC(=C)C1CC(CCC1(C)C=C)C(C)(C)O |
| TCMBANKIN058761 | (E)ocimene | (E)- ocimene; (E)-ocimene;p-Ocimene;3,7-Dimethyl-1,3,6-octatriene;trans-ocimene;trans- beta- Ocimene;ocimene;β-trans-ocimene;3,7-dimethyl-1,3e,6-octatriene;3,7-Dimethylocta-1,3,6-triene; 3,7-Dimethyl-1,3,6-octatriene (natural); beta-trans-Ocimene; EINECS 223-241-5; 74730_FLUKA; 11009-78-2; ST5410145; 3,7-Dimethyl-1,3,6-octatrien; 27400-72-2; FEMA No. 3539; 3,7-DIMETHYL-1,3,6-OCTATRIENE; (E)-3,7-Dimethyloctatriene; 1856-63-9; 11022-64-3; EINECS 237-641-2; BETA-OCIMENE, TRANS; 1,3,6-Octatriene, 3,7-dimethyl-, (E)-; .beta.-trans-Ocimene; 13877-91-3; .beta.-Ocimene; Octatriene, 3,7-dimethyl-, (E)-; beta-Ocimene; trans-beta-Ocimene; 1,3,6-Octatriene, 3,7-dimethyl-; Ocimene, beta-; 3779-61-1; (E)-3,7-Dimethylocta-1,3,6-triene; Ocimene trans-beta-form; (3E)-3,7-dimethylocta-1,3,6-triene; C09873;trans-β-Oci-mene; Trans- β- ocimene; trans-beta-ocimene;EINECS 249-805-0; AC1O5HAL; LS-98065; (3E,5E)-3,7-dimethylocta-1,3,5-triene; 2,6-Dimethyloctane, hexadehydro derivative; 29714-87-2; Dimethyloctatriene (mixed isomer);beta-trans-ocimene;3,7-Dimethylocta-1,3,6-triene; 3,7-Dimethyl-1,3,6-octatriene (natural); beta-trans-Ocimene; EINECS 223-241-5; 74730_FLUKA; 11009-78-2; ST5410145; 3,7-Dimethyl-1,3,6-octatrien; 27400-72-2; FEMA No. 3539; 3,7-DIMETHYL-1,3,6-OCTATRIENE; (E)-3,7-Dimethyloctatriene; 1856-63-9; 11022-64-3; EINECS 237-641-2; BETA-OCIMENE, TRANS; 1,3,6-Octatriene, 3,7-dimethyl-, (E)-; .beta.-trans-Ocimene; 13877-91-3; .beta.-Ocimene; Octatriene, 3,7-dimethyl-, (E)-; beta-Ocimene; trans-beta-Ocimene; 1,3,6-Octatriene, 3,7-dimethyl-; Ocimene, beta-; 3779-61-1; (E)-3,7-Dimethylocta-1,3,6-triene; Ocimene trans-beta-form; (3E)-3,7-dimethylocta-1,3,6-triene; C09873;ci-mene; Trans- β- ocimene; trans-beta-ocimene;EINECS 249-805-0; AC1O5HAL; LS-98065; (3E,5E)-3,7-dimethylocta-1,3,5-triene; 2,6-Dimethyloctane, hexadehydro derivative; 29714-87-2; Dimethyloctatriene (mixed isomer);beta-trans-ocimene | C10H16 | 136.23 g/mol | CC(=CCC=C(C)C=C)C |
| TCMBANKIN058816 | beta-myrcene | 7-Methyl-3-methylene-octa-1,6-diene; DSSTox_RID_77883; Q-201417; CJ-23958; Myrcene, >=95%, stabilized, FCC, FG; A805060; MYRCENE, TECH; 123-35-3; STL477735; FEMA 2762; AN-22914; beta-geraniolene; LS-678; 7-Methyl-3-methylene-1,6-octadiene (myrcene); AK116901; V0542; AI3-00738; .beta.-Myrcene; 7-Methyl-3-methylene-1,6-octadiene (beta -myrcene); Myrcene, analytical standard; NCGC00254252-01; NSC-406264; ST24029965; 7-?Methyl-?3-?methylene-?1,6-?octadiene; RP20298; C06074; NCGC00091420-02; CHEBI:17221; AC1Q1NVC; Tox21_300351; MYRCENE; 2153-31-3; DSSTox_CID_5692; Jsp001569; FEMA No. 2762; FCH1116940; beta -mircene; beta -myrcene; 7-methyl-3-methylidene-octa-1,6-diene; 7-methyl-3-methylideneocta-1,6-diene; β-myrcene; Myrcene (stabilized with BHT); 2-Methyl-6-methylene-2,7-octadiene; BRN 1719990; WLN: 1Y1&U3YU1&1U1; beta- Myrcene; UAHWPYUMFXYFJY-UHFFFAOYSA-N; 7-Methyl-3-methyleneoctadiene-(1,6); 3-Methylene-7-methyl-1, 6-octadiene; NCGC00091420-01; Mycrene Solution, 1000 mg/L, 1 ml (RM, ISO Guide 34); EINECS 204-622-5; DTXSID6025692; DSSTox_GSID_25692; β- myrcene; Myrcene, technical grade; beta-Myrcene; MYRCENE 90; LMPR0102010005; Myrcene, primary pharmaceutical reference standard; NSC 406264; KS-00000WLP; HSDB 1258; AC1Q1J8N; Myrcene, .beta.-; 3M39CZS25B; beta-Myrcene (>90%); TR-003681; AJ-26651; ZINC1530331; FT-0629050; CHEMBL455491; UNII-3M39CZS25B; NSC406264; MolPort-001-792-515; beta-myrcene ; I14-17984; CCRIS 3725; 7-methyl-3-methylene-1,6 octadiene; C-34801; M0235; AKOS015904015; CAS-123-35-3; AC1L1L8S; .beta.-Geraniolene; 7-Methyl-3-methyleneocta-1,6-diene; CC-31053; b-Geraniolene; 7-Methyl-3-methylene-1,6-octadiene; 4-01-00-01108 (Beilstein Handbook Reference); Myrcene (natural); EC 204-622-5; MFCD00008908; b-Myrcene; 1,6-Octadiene, 7-methyl-3-methylene-; 3-Methylene-7-methyl-1,6-octadiene; InChI=1/C10H16/c1-5-10(4)8-6-7-9(2)3/h5,7H,1,4,6,8H2,2-3H; 1, 7-methyl-3-methylene- | C10H16 | 136.23 g/mol | CC(=CCCC(=C)C=C)C |
| TCMBANKIN058832 | Farnesene epoxide,E- | farnesene epoxide | C15H24O | 220.35 g/mol | CC(=CCCC(=CCCC(=C)C1CO1)C)C |
| TCMBANKIN059217 | beta-Bourbonene | (-)-beta-Bourbonene;beta .-Bourbonene;(-)-β-Bour-bonene; Bourbonene, beta-; Cyclobuta(1,2:3,4)dicyclopentene, decahydro-3a-methyl-6-methylene-1-(1-methylethyl)-, (1S-(1alpha,3aalpha,3bbeta,6abeta,6balpha))-; β-bourbonene; Decahydroisopropylmethylmethylenecyclobuta(1,2:3,4)dicyclopentene; beta-bourbonene; 1,2,3,3a,3bbeta,4,5,6,6abeta,6balpha-decahydro-1alpha-isopropyl-3aalpha-methyl-6-methylenecyclobuta(1,2:3,4)dicyclopentene; Decahydro-3a-methyl-6-methylene-1-(1-methylethyl)cyclobuta(1,2:3,4)dicyclopentene, (1S-(1alpha,3aalpha,3bbeta,6abeta,6balpha))-; beta- Bourbonene; 13833-27-7; β- Bourbon ene; Cyclobuta(1,2:3,4)dicyclopentene, 1,2,3,3a,3bbeta,4,5,6,6abeta,6balpha-decahydro-1alpha-isopropyl-3aalpha-methyl-6-methylene | C15H24 | 204.35 | CC(C)C1CCC2(C1C3C2CCC3=C)C |
| TCMBANKIN059348 | isoanwuweizicacid | anwuweizic acid | C30H48O3 | 456.7 g/mol | CC(CCC=C(C)C(=O)O)C1CCC2(C1(CCC3=C2CCC4C3(CCC(C4(C)C)O)C)C)C |
| TCMBANKIN059349 | nigranoicacid | C30H46O4 | 470.7 g/mol | CC(CCC=C(C)C(=O)O)C1CCC2(C1(CCC34C2CCC(C3(C4)CCC(=O)O)C(=C)C)C)C | |
| TCMBANKIN059350 | schizandrolic acid | schizandrolicacid | C30H48O3 | 456.7 g/mol | CC(CCC=C(C)C(=O)O)C1CCC2(C1(CCC34C2CCC5C3(C4)CCC(C5(C)C)O)C)C |
| TCMBANKIN059355 | citronellyl acetate | BSPBio_003127; KBioGR_002371; Spectrum5_000468; Spectrum2_000692; KBio1_001487; SPECTRUM310030; ZINC01680438; DivK1c_006543; Spectrum4_001874; KBio2_006799; KBio3_002347; SpecPlus_000447; acetic acid [(3R)-3,7-dimethyloct-6-enyl] ester; Spectrum_001183; [(3R)-3,7-dimethyloct-6-enyl] ethanoate; SPBio_000843; KBioSS_001663; SDCCGMLS-0066592.P001; Spectrum3_001344; KBio2_001663; KBio2_004231;6-Octen-1-ol,3,7-dimethyl-,acetate;itronellol acetate;[(3R)-3,7-dimethyloct-6-enyl] acetate;AJ-33256; (-)-3,7-Dimethyloct-6-enyl acetate; 6-Octen-1-ol, 3,7-dimethyl-, 1-acetate, (3S)-; UNII-78RZL4H51H; Citronellol acetate, (S)-; (s)-citronellyl acetate; CJ-32447; 67601-05-2; CJ-07629; UNII-IZ420RT3OY component JOZKFWLRHCDGJA-NSHDSACASA-N; ZINC2040946; EINECS 266-767-0; [(3S)-3,7-dimethyloct-6-enyl] acetate; AC1OE5SZ; 6-Octen-1-ol, 3,7-dimethyl-, acetate, (3S)-; (?)-Citronellol acetate; 78RZL4H51H | C12H22O2 | 198.3 g/mol | CC(CCC=C(C)C)CCOC(=O)C |
| TCMBANKIN059502 | 1H-Cycloprop(e)azulen-7-ol, decahydro-1,1,7-trimethyl-4-methylene-, (1aR-(1aalpha,4aalpha,7beta,7abeta,7balpha))- | C15H24O | 220.35 | CC1(C2C1C3C(CCC3(C)O)C(=C)CC2)C | |
| TCMBANKIN059521 | B- pinene;pinene;T-pinene;(-)-nopinene;beta-pinene;bicyclo[3.1.1]heptane,6,6-dimethyl-2-methylene-,(1s);1-β-pinene;()-beta-Pinene;(-)- β- pinene;laevo- β- Pinene | C10H16 | 136.23 g/mol | CC1(C2CCC(=C)C1C2)C | |
| TCMBANKIN059527 | (+)-Camphene | C10H16 | 136.23 g/mol | CC1(C2CCC(C2)C1=C)C | |
| TCMBANKIN059531 | eucalyptol | C10H18O | 154.25 g/mol | CC1(C2CCC(O1)(CC2)C)C | |
| TCMBANKIN059532 | (1R)-1, 7, 7-trimethyl-bicyclo[2.2.1]heptan-2-one | C10H16O | 152.23 g/mol | CC1(C2CCC1(C(=O)C2)C)C | |
| TCMBANKIN059533 | borneol | C10H18O | 154.25 g/mol | CC1(C2CCC1(C(C2)O)C)C | |
| TCMBANKIN059536 | α-fenchene | C10H16 | 136.23 g/mol | CC1(C2CCC1C(=C)C2)C | |
| TCMBANKIN059837 | methyl thymyl ether | C11H16O | 164.24 g/mol | CC1=CC(=C(C=C1)C(C)C)OC | |
| TCMBANKIN059901 | p-xylene | C8H10 | 106.17 | CC1=CC=C(C=C1)C | |
| TCMBANKIN059905 | p-isopropyltoluene;4-Isopropyltoluene;cymene;1-methyl-4-(1-methylethyl)benzene;Cymol;Para cymene;4-Cymol;p-cymene;Dolcymene | C10H14 | 134.22 g/mol | CC1=CC=C(C=C1)C(C)C | |
| TCMBANKIN059911 | cuparene | C15H22 | 202.33 g/mol | CC1=CC=C(C=C1)C2(CCCC2(C)C)C | |
| TCMBANKIN059914 | alpha-terpinene | C10H16 | 136.23 | CC1=CC=C(CC1)C(C)C | |
| TCMBANKIN059921 | o- Cymene | C10H14 | 134.22 g/mol | CC1=CC=CC=C1C(C)C | |
| TCMBANKIN059960 | (-)-g-cadinene | C15H24 | 204.35 g/mol | CC1=CC2C(CC1)C(=C)CCC2C(C)C | |
| TCMBANKIN059962 | cadinen;α-Cadinene;1,2,4a,5,6,8a-hexahydro-4,7-dimethyl-1-(1-methylethyl)naphthalene;1,2,4A,5,6,8A-hexahydro--4,7-dimethyl-(1-methylethyl)-naphthalene;muurolene;1,2,4a,5,6,8a- hexhydro- 4,7- dimethyl- 1-(1- methylethyl)-(1alpha 4a． alpha．,8a alpha． )- naphthalene;alpha cadinene;α-muurolene | C15H24 | 204.35 g/mol | CC1=CC2C(CC1)C(=CCC2C(C)C)C | |
| TCMBANKIN059970 | 1, 4-Cyclohexadiene, 1-methyl-4-(1-methylethyl);crithmene;4-Isopropyl-1-methyl-1,4-cyclohexadiene;Moslene;gamma-terpinene | C10H16 | 136.23 g/mol | CC1=CCC(=CC1)C(C)C | |
| TCMBANKIN059974 | alpha-phellandrene | C10H16 | 136.23 | CC1=CCC(C=C1)C(C)C | |
| TCMBANKIN059980 | 4-methyl-1-isopropyl-3-cyclohexen-1-ol | C10H18O | 154.25 g/mol | CC1=CCC(CC1)(C(C)C)O | |
| TCMBANKIN059983 | β-bisabolene | C15H24 | 204.35 g/mol | CC1=CCC(CC1)C(=C)CCC=C(C)C | |
| TCMBANKIN059985 | alpha-terpinol | C10H18O | 154.25 g/mol | CC1=CCC(CC1)C(C)(C)O | |
| TCMBANKIN059996 | Kadsulactone A | C30H42O5 | 482.65 | CC1=CCC(OC1=O)C(C)C2CCC3(C2(CCC45C3CC(C6C4(C5)C=CC(=O)OC6(C)C)O)C)C | |
| TCMBANKIN059997 | schisanlactone E | C30H44O4 | 468.67 | CC1=CCC(OC1=O)C(C)C2CCC3(C2(CCC45C3CCC(C4(C5)CCC(=O)O)C(=C)C)C)C | |
| TCMBANKIN059999 | beta-Chamigrene | C15H24 | 204.35 g/mol | CC1=CCC2(CC1)C(=C)CCCC2(C)C | |
| TCMBANKIN060001 | thujopsene | C15H24 | 204.35 g/mol | CC1=CCC2(CCCC(C23C1C3)(C)C)C | |
| TCMBANKIN060009 | copaene; (-)-Alpha-Copaene; α-copaene | C15H24 | 204.35 g/mol | CC1=CCC2C3C1C2(CCC3C(C)C)C | |
| TCMBANKIN060012 | alpha-bergamotene | C15H24 | 204.35 g/mol | CC1=CCC2CC1C2(C)CCC=C(C)C | |
| TCMBANKIN060014 | Germacrene D | C15H24 | 204.35 g/mol | CC1=CCCC(=C)C=CC(CC1)C(C)C | |
| TCMBANKIN060015 | 9-epi-(E)-caryophyllene | C15H24 | 204.35 g/mol | CC1=CCCC(=C)C2CC(C2CC1)(C)C | |
| TCMBANKIN060019 | Germacrene B | C15H24 | 204.35 | CC1=CCCC(=CCC(=C(C)C)CC1)C | |
| TCMBANKIN060332 | thujene | C10H16 | 136.23 g/mol | CC1C=CC2(C1C2)C(C)C | |
| TCMBANKIN060416 | Isoschisandrin | C24H32O7 | 432.51g/mol | CC1CC2=CC(=C(C(=C2C3=C(C(=C(C=C3CC1(C)O)OC)OC)OC)OC)OC)OC | |
| TCMBANKIN060421 | gomisin | C30H32O9 | 536.6 g/mol | CC1CC2=CC3=C(C(=C2C4=C(C(=C(C=C4C(C1(C)O)OC(=O)C5=CC=CC=C5)OC)OC)OC)OC)OCO3 | |
| TCMBANKIN060453 | α-acoradiene;Acoradiene | C15H24 | 204.35 | CC1CCC(C12CCC(=CC2)C)C(=C)C | |
| TCMBANKIN060566 | β-patchoulene | C15H24 | 204.35 | CC1CCC2=C1CC3CCC2(C3(C)C)C | |
| TCMBANKIN060575 | alpha-gurjunene | C15H24 | 204.35 g/mol | CC1CCC2C(C2(C)C)C3=C(CCC13)C | |
| TCMBANKIN060586 | Cedren-13-ol, 8-;cedr-8-en-13-ol | C15H24O | 220.35 | CC1CCC2C13CC=C(C(C3)C2(C)CO)C | |
| TCMBANKIN060888 | caproaldehyde | C6H12O | 100.16 g/mol | CCCCCC=O | |
| TCMBANKIN061005 | TRIDECANONE | C13H26O | 198.34g/mol | CCCCCCCCCCCC(=O)C |
植物对应的疾病
| 疾病ID | 病名 | 疾病类型 | MeSH | 参考文献 |
|---|
植物对应的靶点
| 靶点ID | 基因名 | 基因别名 | 描述 | 染色体位置 | Map_Location | 基因类型 |
|---|
滇ICP备16009434号-1 |
Dai SX Lab